EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H18N3O3 |
| Net Charge | +1 |
| Average Mass | 204.250 |
| Monoisotopic Mass | 204.13427 |
| SMILES | [NH3+]CCCC[C@H]([NH3+])C(=O)NCC(=O)[O-] |
| InChI | InChI=1S/C8H17N3O3/c9-4-2-1-3-6(10)8(14)11-5-7(12)13/h6H,1-5,9-10H2,(H,11,14)(H,12,13)/p+1/t6-/m0/s1 |
| InChIKey | HGNRJCINZYHNOU-LURJTMIESA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Lys-Gly(1+) (CHEBI:191202) is a peptide cation (CHEBI:60194) |
| Lys-Gly(1+) (CHEBI:191202) is conjugate acid of Lys-Gly (CHEBI:73604) |
| Incoming Relation(s) |
| Lys-Gly (CHEBI:73604) is conjugate base of Lys-Gly(1+) (CHEBI:191202) |
| IUPAC Name |
|---|
| {[(2S)-2,6-bis(azaniumyl)hexanoyl]amino}acetate |
| Synonyms | Source |
|---|---|
| KG(1+) | ChEBI |
| lysylglycine(1+) | ChEBI |
| L-Lys-Gly(1+) | ChEBI |
| L-lysylglycine(1+) | ChEBI |
| L-lysylglycine cation | ChEBI |
| UniProt Name | Source |
|---|---|
| L-lysyl-glycine | UniProt |
| Citations |
|---|