EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H8O6 |
| Net Charge | -2 |
| Average Mass | 188.135 |
| Monoisotopic Mass | 188.03319 |
| SMILES | O=C([O-])CCC(O)CC(=O)C(=O)[O-] |
| InChI | InChI=1S/C7H10O6/c8-4(1-2-6(10)11)3-5(9)7(12)13/h4,8H,1-3H2,(H,10,11)(H,12,13)/p-2 |
| InChIKey | HNOAJOYERZTSNK-UHFFFAOYSA-L |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-hydroxy-2-oxoheptanedioate (CHEBI:73036) has functional parent pimelate(2−) (CHEBI:36165) |
| 4-hydroxy-2-oxoheptanedioate (CHEBI:73036) is a dicarboxylic acid dianion (CHEBI:28965) |
| 4-hydroxy-2-oxoheptanedioate (CHEBI:73036) is conjugate base of 4-hydroxy-2-oxoheptanedioic acid (CHEBI:73089) |
| 4-hydroxy-2-oxoheptanedioate (CHEBI:73036) is tautomer of 2,4-dihydroxyhept-2-enedioate (CHEBI:58936) |
| Incoming Relation(s) |
| (S)-4-hydroxy-2-oxoheptanedioate (CHEBI:87522) is a 4-hydroxy-2-oxoheptanedioate (CHEBI:73036) |
| 4-hydroxy-2-oxoheptanedioic acid (CHEBI:73089) is conjugate acid of 4-hydroxy-2-oxoheptanedioate (CHEBI:73036) |
| 2,4-dihydroxyhept-2-enedioate (CHEBI:58936) is tautomer of 4-hydroxy-2-oxoheptanedioate (CHEBI:73036) |
| IUPAC Name |
|---|
| 4-hydroxy-2-oxoheptanedioate |
| Synonyms | Source |
|---|---|
| 2-keto-4-hydroxypimelate | MetaCyc |
| 2-oxo-4-hydroxyhepta-1,7-dioate | MetaCyc |
| 4-hydroxy-2-ketoheptane-1,7-dioate | MetaCyc |
| 4-hydroxy-2-ketoheptanedioate | ChEBI |
| 4-hydroxy-2-ketopimelate | MetaCyc |
| UniProt Name | Source |
|---|---|
| 4-hydroxy-2-oxoheptanedioate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-804 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21272089 | Reaxys |
| Citations |
|---|