EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H8O6 |
| Net Charge | -2 |
| Average Mass | 188.135 |
| Monoisotopic Mass | 188.03319 |
| SMILES | O=C([O-])CC[C@H](O)CC(=O)C(=O)[O-] |
| InChI | InChI=1S/C7H10O6/c8-4(1-2-6(10)11)3-5(9)7(12)13/h4,8H,1-3H2,(H,10,11)(H,12,13)/p-2/t4-/m0/s1 |
| InChIKey | HNOAJOYERZTSNK-BYPYZUCNSA-L |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-4-hydroxy-2-oxoheptanedioate (CHEBI:87522) is a 4-hydroxy-2-oxoheptanedioate (CHEBI:73036) |
| (S)-4-hydroxy-2-oxoheptanedioate (CHEBI:87522) is conjugate base of (S)-4-hydroxy-2-oxoheptanedioic acid (CHEBI:87773) |
| Incoming Relation(s) |
| (S)-4-hydroxy-2-oxoheptanedioic acid (CHEBI:87773) is conjugate acid of (S)-4-hydroxy-2-oxoheptanedioate (CHEBI:87522) |
| IUPAC Name |
|---|
| (4S)-4-hydroxy-2-oxoheptanedioate |
| UniProt Name | Source |
|---|---|
| (4S)-4-hydroxy-2-oxoheptanedioate | UniProt |