EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H10O4 |
| Net Charge | -2 |
| Average Mass | 158.153 |
| Monoisotopic Mass | 158.05901 |
| SMILES | O=C([O-])CCCCCC(=O)[O-] |
| InChI | InChI=1S/C7H12O4/c8-6(9)4-2-1-3-5-7(10)11/h1-5H2,(H,8,9)(H,10,11)/p-2 |
| InChIKey | WLJVNTCWHIRURA-UHFFFAOYSA-L |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pimelate(2−) (CHEBI:36165) is a dicarboxylic acid dianion (CHEBI:28965) |
| pimelate(2−) (CHEBI:36165) is a pimelate (CHEBI:133773) |
| pimelate(2−) (CHEBI:36165) is conjugate base of pimelate(1−) (CHEBI:17774) |
| Incoming Relation(s) |
| N-acetyl-LL-2,6-diaminopimelate(2−) (CHEBI:18317) has functional parent pimelate(2−) (CHEBI:36165) |
| L-2-succinylamino-6-oxoheptanedioate(3−) (CHEBI:15685) has functional parent pimelate(2−) (CHEBI:36165) |
| 2-oxopimelate(2−) (CHEBI:72701) has functional parent pimelate(2−) (CHEBI:36165) |
| 2,6-diaminopimelate(2−) (CHEBI:23671) has functional parent pimelate(2−) (CHEBI:36165) |
| 4-hydroxy-2-oxoheptanedioate (CHEBI:73036) has functional parent pimelate(2−) (CHEBI:36165) |
| pimelate(1−) (CHEBI:17774) is conjugate acid of pimelate(2−) (CHEBI:36165) |
| IUPAC Name |
|---|
| heptanedioate |
| UniProt Name | Source |
|---|---|
| heptanedioate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-205 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Gmelin:363895 | Gmelin |
| Reaxys:3905193 | Reaxys |