EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H10O6 |
| Net Charge | 0 |
| Average Mass | 190.151 |
| Monoisotopic Mass | 190.04774 |
| SMILES | O=C(O)CCC(O)CC(=O)C(=O)O |
| InChI | InChI=1S/C7H10O6/c8-4(1-2-6(10)11)3-5(9)7(12)13/h4,8H,1-3H2,(H,10,11)(H,12,13) |
| InChIKey | HNOAJOYERZTSNK-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-hydroxy-2-oxoheptanedioic acid (CHEBI:73089) has functional parent pimelic acid (CHEBI:30531) |
| 4-hydroxy-2-oxoheptanedioic acid (CHEBI:73089) is a dicarboxylic fatty acid (CHEBI:189840) |
| 4-hydroxy-2-oxoheptanedioic acid (CHEBI:73089) is a oxo dicarboxylic acid (CHEBI:36145) |
| 4-hydroxy-2-oxoheptanedioic acid (CHEBI:73089) is conjugate acid of 4-hydroxy-2-oxoheptanedioate (CHEBI:73036) |
| 4-hydroxy-2-oxoheptanedioic acid (CHEBI:73089) is tautomer of 2,4-dihydroxyhept-2-enedioic acid (CHEBI:915) |
| Incoming Relation(s) |
| (S)-4-hydroxy-2-oxoheptanedioic acid (CHEBI:87773) is a 4-hydroxy-2-oxoheptanedioic acid (CHEBI:73089) |
| 4-hydroxy-2-oxoheptanedioate (CHEBI:73036) is conjugate base of 4-hydroxy-2-oxoheptanedioic acid (CHEBI:73089) |
| 2,4-dihydroxyhept-2-enedioic acid (CHEBI:915) is tautomer of 4-hydroxy-2-oxoheptanedioic acid (CHEBI:73089) |
| IUPAC Name |
|---|
| 4-hydroxy-2-oxoheptanedioic acid |
| Synonyms | Source |
|---|---|
| 2-keto-4-hydroxypimelic acid | ChEBI |
| 2-oxo-4-hydroxyhepta-1,7-dioic acid | ChEBI |
| 4-hydroxy-2-ketoheptane-1,7-dioic acid | ChEBI |
| 4-hydroxy-2-ketoheptanedioic acid | ChEBI |
| 4-Hydroxy-2-ketopimelate | KEGG COMPOUND |
| 4-hydroxy-2-ketopimelic acid | ChEBI |
| Citations |
|---|