EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H30O3 |
| Net Charge | 0 |
| Average Mass | 318.457 |
| Monoisotopic Mass | 318.21949 |
| SMILES | CCC(O)/C=C/C=C\C/C=C\C/C=C\C/C=C\CCCC(=O)O |
| InChI | InChI=1S/C20H30O3/c1-2-19(21)17-15-13-11-9-7-5-3-4-6-8-10-12-14-16-18-20(22)23/h4-7,10-13,15,17,19,21H,2-3,8-9,14,16,18H2,1H3,(H,22,23)/b6-4-,7-5-,12-10-,13-11-,17-15+ |
| InChIKey | LRWYBGFSVUBWMO-UXNZXXPISA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 18-HEPE (CHEBI:72802) has role human xenobiotic metabolite (CHEBI:76967) |
| 18-HEPE (CHEBI:72802) is a HEPE (CHEBI:72799) |
| 18-HEPE (CHEBI:72802) is conjugate acid of 18-HEPE(1−) (CHEBI:90825) |
| Incoming Relation(s) |
| 18(R)-HEPE (CHEBI:81563) is a 18-HEPE (CHEBI:72802) |
| 18(S)-HEPE (CHEBI:132801) is a 18-HEPE (CHEBI:72802) |
| 18-HEPE(1−) (CHEBI:90825) is conjugate base of 18-HEPE (CHEBI:72802) |
| IUPAC Name |
|---|
| (5Z,8Z,11Z,14Z,16E)-18-hydroxyicosa-5,8,11,14,16-pentaenoic acid |
| Synonyms | Source |
|---|---|
| (±)-18-HEPE | LIPID MAPS |
| (±)-18-hydroxy-5Z,8Z,11Z,14Z,16E-eicosapentaenoic acid | LIPID MAPS |
| Manual Xrefs | Databases |
|---|---|
| LMFA03070033 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:14339377 | Reaxys |