EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:132801 - 18(S)-HEPE
| Formula | C20H30O3 |
| Net Charge | 0 |
| Average Mass | 318.457 |
| Monoisotopic Mass | 318.21949 |
| SMILES | CC[C@H](O)/C=C/C=C\C/C=C\C/C=C\C/C=C\CCCC(=O)O |
| InChI | InChI=1S/C20H30O3/c1-2-19(21)17-15-13-11-9-7-5-3-4-6-8-10-12-14-16-18-20(22)23/h4-7,10-13,15,17,19,21H,2-3,8-9,14,16,18H2,1H3,(H,22,23)/b6-4-,7-5-,12-10-,13-11-,17-15+/t19-/m0/s1 |
| InChIKey | LRWYBGFSVUBWMO-OKIFYYRFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (21206090) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | human blood serum metabolite Any metabolite (endogenous or exogenous) found in human blood serum samples. human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 18(S)-HEPE (CHEBI:132801) has role anti-inflammatory agent (CHEBI:67079) |
| 18(S)-HEPE (CHEBI:132801) has role human blood serum metabolite (CHEBI:85234) |
| 18(S)-HEPE (CHEBI:132801) has role human xenobiotic metabolite (CHEBI:76967) |
| 18(S)-HEPE (CHEBI:132801) is a 18-HEPE (CHEBI:72802) |
| 18(S)-HEPE (CHEBI:132801) is conjugate acid of 18(S)-HEPE(1−) (CHEBI:132083) |
| 18(S)-HEPE (CHEBI:132801) is enantiomer of 18(R)-HEPE (CHEBI:81563) |
| Incoming Relation(s) |
| 18(S)-HEPE(1−) (CHEBI:132083) is conjugate base of 18(S)-HEPE (CHEBI:132801) |
| 18(R)-HEPE (CHEBI:81563) is enantiomer of 18(S)-HEPE (CHEBI:132801) |
| IUPAC Name |
|---|
| (5Z,8Z,11Z,14Z,16E,18S)-18-hydroxyicosa-5,8,11,14,16-pentaenoic acid |
| Synonyms | Source |
|---|---|
| (18S)-hydroxy-(5Z,8Z,11Z,14Z,16E)-icosapentaenoic acid | ChEBI |
| (18S)-hydroxy-(5Z,8Z,11Z,14Z,16E)-eicosapentaenoic acid | ChEBI |
| 18S-hydroxy-5Z,8Z,11Z,14Z,16E-eicosapentaenoic acid | LIPID MAPS |
| 18S-HEPE | LIPID MAPS |
| Manual Xrefs | Databases |
|---|---|
| LMFA03070038 | LIPID MAPS |
| Citations |
|---|