EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H30O3 |
| Net Charge | 0 |
| Average Mass | 318.457 |
| Monoisotopic Mass | 318.21949 |
| SMILES | CC[C@@H](O)/C=C/C=C\C/C=C\C/C=C\C/C=C\CCCC(=O)O |
| InChI | InChI=1S/C20H30O3/c1-2-19(21)17-15-13-11-9-7-5-3-4-6-8-10-12-14-16-18-20(22)23/h4-7,10-13,15,17,19,21H,2-3,8-9,14,16,18H2,1H3,(H,22,23)/b6-4-,7-5-,12-10-,13-11-,17-15+/t19-/m1/s1 |
| InChIKey | LRWYBGFSVUBWMO-UAAZXLHOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | - | PubMed (11034610) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 18(R)-HEPE (CHEBI:81563) has role anti-inflammatory agent (CHEBI:67079) |
| 18(R)-HEPE (CHEBI:81563) has role mouse metabolite (CHEBI:75771) |
| 18(R)-HEPE (CHEBI:81563) is a 18-HEPE (CHEBI:72802) |
| 18(R)-HEPE (CHEBI:81563) is conjugate acid of 18(R)-HEPE(1−) (CHEBI:90818) |
| 18(R)-HEPE (CHEBI:81563) is enantiomer of 18(S)-HEPE (CHEBI:132801) |
| Incoming Relation(s) |
| 18(R)-HEPE(1−) (CHEBI:90818) is conjugate base of 18(R)-HEPE (CHEBI:81563) |
| 18(S)-HEPE (CHEBI:132801) is enantiomer of 18(R)-HEPE (CHEBI:81563) |
| Synonyms | Source |
|---|---|
| 18R-Hydroxy-5Z,8Z,11Z,14Z,16E-eicosapentaenoic acid | KEGG COMPOUND |
| 18-HEPE | HMDB |
| 18(R)-Hydroxyeicosa-5Z,8Z,11E,14Z,16E-pentaenoic acid | HMDB |
| 18R-HEPE | ChEBI |
| (5Z,8Z,11Z,14Z,16E,18R)-18-hydroxyicosapentaenoic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C18177 | KEGG COMPOUND |
| HMDB0012611 | HMDB |
| LMFA03070025 | LIPID MAPS |
| CPD66-68 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21591942 | Reaxys |
| Citations |
|---|