EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H29O3 |
| Net Charge | -1 |
| Average Mass | 317.449 |
| Monoisotopic Mass | 317.21222 |
| SMILES | CCC(O)/C=C/C=C\C/C=C\C/C=C\C/C=C\CCCC(=O)[O-] |
| InChI | InChI=1S/C20H30O3/c1-2-19(21)17-15-13-11-9-7-5-3-4-6-8-10-12-14-16-18-20(22)23/h4-7,10-13,15,17,19,21H,2-3,8-9,14,16,18H2,1H3,(H,22,23)/p-1/b6-4-,7-5-,12-10-,13-11-,17-15+ |
| InChIKey | LRWYBGFSVUBWMO-UXNZXXPISA-M |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (17114001) |
| Roles Classification |
|---|
| Biological Role: | human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 18-HEPE(1−) (CHEBI:90825) has role human xenobiotic metabolite (CHEBI:76967) |
| 18-HEPE(1−) (CHEBI:90825) is a hydroxy fatty acid anion (CHEBI:59835) |
| 18-HEPE(1−) (CHEBI:90825) is a icosanoid anion (CHEBI:62937) |
| 18-HEPE(1−) (CHEBI:90825) is a long-chain fatty acid anion (CHEBI:57560) |
| 18-HEPE(1−) (CHEBI:90825) is a polyunsaturated fatty acid anion (CHEBI:76567) |
| 18-HEPE(1−) (CHEBI:90825) is conjugate base of 18-HEPE (CHEBI:72802) |
| Incoming Relation(s) |
| 18(S)-HEPE(1−) (CHEBI:132083) is a 18-HEPE(1−) (CHEBI:90825) |
| 18-HEPE (CHEBI:72802) is conjugate acid of 18-HEPE(1−) (CHEBI:90825) |
| IUPAC Name |
|---|
| (5Z,8Z,11Z,14Z,16E)-18-hydroxyicosa-5,8,11,14,16-pentaenoate |
| Synonyms | Source |
|---|---|
| 18-hydroxy-(5Z,8Z,11Z,14Z,16E)-eicosapentaenoate | SUBMITTER |
| 18-hydroxy-(5Z,8Z,11Z,14Z,16E)-icosapentaenoate | ChEBI |
| (5Z,8Z,11Z,14Z,16E)-18-hydroxyicosapentaenoate | ChEBI |
| UniProt Name | Source |
|---|---|
| 18-HEPE | UniProt |
| Citations |
|---|