EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H14O6 |
| Net Charge | 0 |
| Average Mass | 374.348 |
| Monoisotopic Mass | 374.07904 |
| SMILES | CC(C1=C(O)C(=O)c2ccccc2C1=O)C1=C(O)C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C22H14O6/c1-10(15-17(23)11-6-2-4-8-13(11)19(25)21(15)27)16-18(24)12-7-3-5-9-14(12)20(26)22(16)28/h2-10,27-28H,1H3 |
| InChIKey | GCPCQGFKPFLVPN-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | EC 1.3.1.22 [3-oxo-5alpha-steroid 4-dehydrogenase (NADP(+))] inhibitor An EC 1.3.1.* (oxidoreductase acting on CH-CH group of donor, NAD+ or NADP+ as acceptor) inhibitor that interferes with the action of of 3-oxo-5α-steroid 4-dehydrogenase (NADP+), EC 1.3.1.22, the enzyme which converts testosterone (CHEBI:17347) into the more potent androgen 5α-dihydrotestosterone. cyclooxygenase 2 inhibitor A cyclooxygenase inhibitor that interferes with the action of cyclooxygenase 2. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antipruritic drug A drug, usually applied topically, that relieves pruritus (itching). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| impatienol (CHEBI:72634) has role antipruritic drug (CHEBI:59683) |
| impatienol (CHEBI:72634) has role cyclooxygenase 2 inhibitor (CHEBI:50629) |
| impatienol (CHEBI:72634) has role EC 1.3.1.22 [3-oxo-5α-steroid 4-dehydrogenase (NADP+)] inhibitor (CHEBI:50781) |
| impatienol (CHEBI:72634) has role metabolite (CHEBI:25212) |
| impatienol (CHEBI:72634) is a hydroxy-1,4-naphthoquinone (CHEBI:132157) |
| impatienol (CHEBI:72634) is conjugate acid of impatienol(2−) (CHEBI:72635) |
| Incoming Relation(s) |
| impatienol(2−) (CHEBI:72635) is conjugate base of impatienol (CHEBI:72634) |
| IUPAC Name |
|---|
| 2,2'-ethane-1,1-diylbis(3-hydroxy-1,4-naphthoquinone) |
| Synonym | Source |
|---|---|
| 2,2'-ethylenebis(3-hydroxy-1,4-naphthoquinone) | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2678514 | Reaxys |
| Citations |
|---|