EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H14O6 |
| Net Charge | 0 |
| Average Mass | 374.348 |
| Monoisotopic Mass | 374.07904 |
| SMILES | CC(C1=C(O)C(=O)c2ccccc2C1=O)C1=C(O)C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C22H14O6/c1-10(15-17(23)11-6-2-4-8-13(11)19(25)21(15)27)16-18(24)12-7-3-5-9-14(12)20(26)22(16)28/h2-10,27-28H,1H3 |
| InChIKey | GCPCQGFKPFLVPN-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. cyclooxygenase 2 inhibitor A cyclooxygenase inhibitor that interferes with the action of cyclooxygenase 2. EC 1.3.1.22 [3-oxo-5alpha-steroid 4-dehydrogenase (NADP(+))] inhibitor An EC 1.3.1.* (oxidoreductase acting on CH-CH group of donor, NAD+ or NADP+ as acceptor) inhibitor that interferes with the action of of 3-oxo-5α-steroid 4-dehydrogenase (NADP+), EC 1.3.1.22, the enzyme which converts testosterone (CHEBI:17347) into the more potent androgen 5α-dihydrotestosterone. |
| Application: | antipruritic drug A drug, usually applied topically, that relieves pruritus (itching). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| impatienol (CHEBI:72634) has role antipruritic drug (CHEBI:59683) |
| impatienol (CHEBI:72634) has role cyclooxygenase 2 inhibitor (CHEBI:50629) |
| impatienol (CHEBI:72634) has role EC 1.3.1.22 [3-oxo-5α-steroid 4-dehydrogenase (NADP+)] inhibitor (CHEBI:50781) |
| impatienol (CHEBI:72634) has role metabolite (CHEBI:25212) |
| impatienol (CHEBI:72634) is a hydroxy-1,4-naphthoquinone (CHEBI:132157) |
| impatienol (CHEBI:72634) is conjugate acid of impatienol(2−) (CHEBI:72635) |
| Incoming Relation(s) |
| impatienol(2−) (CHEBI:72635) is conjugate base of impatienol (CHEBI:72634) |
| IUPAC Name |
|---|
| 2,2'-ethane-1,1-diylbis(3-hydroxy-1,4-naphthoquinone) |
| Synonym | Source |
|---|---|
| 2,2'-ethylenebis(3-hydroxy-1,4-naphthoquinone) | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2678514 | Reaxys |
| Citations |
|---|