EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H12O6 |
| Net Charge | -2 |
| Average Mass | 372.332 |
| Monoisotopic Mass | 372.06449 |
| SMILES | CC(C1=C([O-])C(=O)c2ccccc2C1=O)C1=C([O-])C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C22H14O6/c1-10(15-17(23)11-6-2-4-8-13(11)19(25)21(15)27)16-18(24)12-7-3-5-9-14(12)20(26)22(16)28/h2-10,27-28H,1H3/p-2 |
| InChIKey | GCPCQGFKPFLVPN-UHFFFAOYSA-L |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| impatienol(2−) (CHEBI:72635) is a enolate (CHEBI:142839) |
| impatienol(2−) (CHEBI:72635) is conjugate base of impatienol (CHEBI:72634) |
| Incoming Relation(s) |
| impatienolate (CHEBI:66069) has part impatienol(2−) (CHEBI:72635) |
| impatienol (CHEBI:72634) is conjugate acid of impatienol(2−) (CHEBI:72635) |