EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H10O3 |
| Net Charge | 0 |
| Average Mass | 154.165 |
| Monoisotopic Mass | 154.06299 |
| SMILES | CC1(C)C(O)=CC(=O)C=C1O |
| InChI | InChI=1S/C8H10O3/c1-8(2)6(10)3-5(9)4-7(8)11/h3-4,10-11H,1-2H3 |
| InChIKey | ZITLVRQXJUFZOO-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| filicinic acid (CHEBI:71593) has functional parent phloroglucinol (CHEBI:16204) |
| filicinic acid (CHEBI:71593) has role metabolite (CHEBI:25212) |
| filicinic acid (CHEBI:71593) is a enol (CHEBI:33823) |
| filicinic acid (CHEBI:71593) is a enone (CHEBI:51689) |
| Incoming Relation(s) |
| drummondin D (CHEBI:65809) has functional parent filicinic acid (CHEBI:71593) |
| drummondin E (CHEBI:65810) has functional parent filicinic acid (CHEBI:71593) |
| drummondin F (CHEBI:65811) has functional parent filicinic acid (CHEBI:71593) |
| isodrummondin D (CHEBI:65812) has functional parent filicinic acid (CHEBI:71593) |
| IUPAC Name |
|---|
| 3,5-dihydroxy-4,4-dimethylcyclohexa-2,5-dien-1-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2046871 | Reaxys |
| CAS:2065-00-1 | ChemIDplus |
| Citations |
|---|