EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H34O8 |
| Net Charge | 0 |
| Average Mass | 498.572 |
| Monoisotopic Mass | 498.22537 |
| SMILES | CC(=O)C1=C(O)C(C)(CC=C(C)C)C(O)=C(Cc2c(OCC=C(C)C)cc(O)c(C(C)=O)c2O)C1=O |
| InChI | InChI=1S/C28H34O8/c1-14(2)8-10-28(7)26(34)19(25(33)23(17(6)30)27(28)35)12-18-21(36-11-9-15(3)4)13-20(31)22(16(5)29)24(18)32/h8-9,13,31-32,34-35H,10-12H2,1-7H3 |
| InChIKey | LACABBHUBUCHAU-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Hypericum drummondii (ncbitaxon:673924) | root (BTO:0001188) | PubMed (1800634) |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| drummondin E (CHEBI:65810) has functional parent filicinic acid (CHEBI:71593) |
| drummondin E (CHEBI:65810) has role antibacterial agent (CHEBI:33282) |
| drummondin E (CHEBI:65810) has role metabolite (CHEBI:25212) |
| drummondin E (CHEBI:65810) is a aromatic ether (CHEBI:35618) |
| drummondin E (CHEBI:65810) is a aromatic ketone (CHEBI:76224) |
| drummondin E (CHEBI:65810) is a enol (CHEBI:33823) |
| drummondin E (CHEBI:65810) is a enone (CHEBI:51689) |
| drummondin E (CHEBI:65810) is a methyl ketone (CHEBI:51867) |
| drummondin E (CHEBI:65810) is a resorcinols (CHEBI:33572) |
| IUPAC Name |
|---|
| 2-acetyl-6-{3-acetyl-2,4-dihydroxy-6-[(3-methylbut-2-en-1-yl)oxy]benzyl}-3,5-dihydroxy-4-methyl-4-(3-methylbut-2-en-1-yl)cyclohexa-2,5-dien-1-one |
| Synonym | Source |
|---|---|
| (+)-drummondin E | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:138169-54-7 | ChemIDplus |
| Citations |
|---|