EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H34O8 |
| Net Charge | 0 |
| Average Mass | 498.572 |
| Monoisotopic Mass | 498.22537 |
| SMILES | CC(=O)C1=C(O)C(C)(CC=C(C)C)C(O)=C(Cc2c(O)c(CC=C(C)C)c(O)c(C(C)=O)c2O)C1=O |
| InChI | InChI=1S/C28H34O8/c1-13(2)8-9-17-22(31)18(24(33)20(15(5)29)23(17)32)12-19-25(34)21(16(6)30)27(36)28(7,26(19)35)11-10-14(3)4/h8,10,31-33,35-36H,9,11-12H2,1-7H3 |
| InChIKey | WWTZMJRKACJQRR-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Hypericum drummondii (ncbitaxon:673924) | root (BTO:0001188) | PubMed (1800634) |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| drummondin F (CHEBI:65811) has functional parent filicinic acid (CHEBI:71593) |
| drummondin F (CHEBI:65811) has role antibacterial agent (CHEBI:33282) |
| drummondin F (CHEBI:65811) has role metabolite (CHEBI:25212) |
| drummondin F (CHEBI:65811) is a aromatic ketone (CHEBI:76224) |
| drummondin F (CHEBI:65811) is a benzenetriol (CHEBI:22707) |
| drummondin F (CHEBI:65811) is a enol (CHEBI:33823) |
| drummondin F (CHEBI:65811) is a enone (CHEBI:51689) |
| drummondin F (CHEBI:65811) is a methyl ketone (CHEBI:51867) |
| IUPAC Name |
|---|
| 2-acetyl-6-[3-acetyl-2,4,6-trihydroxy-5-(3-methylbut-2-en-1-yl)benzyl]-3,5-dihydroxy-4-methyl-4-(3-methylbut-2-en-1-yl)cyclohexa-2,5-dien-1-one |
| Synonym | Source |
|---|---|
| (+)-drummondin F | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:122127-73-5 | ChemIDplus |
| Citations |
|---|