EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H32O8 |
| Net Charge | 0 |
| Average Mass | 496.556 |
| Monoisotopic Mass | 496.20972 |
| SMILES | CC(=O)C1=C(O)C(C)(CC=C(C)C)C(O)=C(Cc2c(O)c(C(C)=O)c(O)c3c2OC(C)(C)C=C3)C1=O |
| InChI | InChI=1S/C28H32O8/c1-13(2)8-11-28(7)25(34)18(23(33)20(15(4)30)26(28)35)12-17-22(32)19(14(3)29)21(31)16-9-10-27(5,6)36-24(16)17/h8-10,31-32,34-35H,11-12H2,1-7H3 |
| InChIKey | QDEXSBYEIYRPIT-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Hypericum drummondii (ncbitaxon:673924) | root (BTO:0001188) | PubMed (1800634) |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| isodrummondin D (CHEBI:65812) has functional parent filicinic acid (CHEBI:71593) |
| isodrummondin D (CHEBI:65812) has role antibacterial agent (CHEBI:33282) |
| isodrummondin D (CHEBI:65812) has role metabolite (CHEBI:25212) |
| isodrummondin D (CHEBI:65812) is a aromatic ketone (CHEBI:76224) |
| isodrummondin D (CHEBI:65812) is a chromenol (CHEBI:39436) |
| isodrummondin D (CHEBI:65812) is a enol (CHEBI:33823) |
| isodrummondin D (CHEBI:65812) is a enone (CHEBI:51689) |
| isodrummondin D (CHEBI:65812) is a methyl ketone (CHEBI:51867) |
| IUPAC Name |
|---|
| 2-acetyl-6-[(6-acetyl-5,7-dihydroxy-2,2-dimethyl-2H-chromen-8-yl)methyl]-3,5-dihydroxy-4-methyl-4-(3-methylbut-2-en-1-yl)cyclohexa-2,5-dien-1-one |
| Synonym | Source |
|---|---|
| (+)-isodrummondin D | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:138169-53-6 | ChemIDplus |
| Citations |
|---|