EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H52 |
| Net Charge | 0 |
| Average Mass | 412.746 |
| Monoisotopic Mass | 412.40690 |
| SMILES | [H][C@]12CC[C@]3(C)[C@@H](C)CCC[C@@]3([H])[C@]1(C)CC[C@@]1(C)[C@]3([H])CC(C)(C)CC[C@]3(C)CC[C@]21C |
| InChI | InChI=1S/C30H52/c1-21-10-9-11-22-27(21,5)13-12-23-28(22,6)17-19-30(8)24-20-25(2,3)14-15-26(24,4)16-18-29(23,30)7/h21-24H,9-20H2,1-8H3/t21-,22+,23-,24+,26+,27+,28-,29+,30-/m0/s1 |
| InChIKey | KVSNMTUIMXZPLU-XOZXFAFYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| friedelane (CHEBI:71575) has role metabolite (CHEBI:25212) |
| friedelane (CHEBI:71575) is a triterpene (CHEBI:35191) |
| Incoming Relation(s) |
| 28,29-dihydroxyfriedelan-3-one (CHEBI:65788) has parent hydride friedelane (CHEBI:71575) |
| 29-hydroxyfriedelan-3-one (CHEBI:132374) has parent hydride friedelane (CHEBI:71575) |
| cangoronin (CHEBI:132380) has parent hydride friedelane (CHEBI:71575) |
| canophyllal (CHEBI:132345) has parent hydride friedelane (CHEBI:71575) |
| orthosphenic acid (CHEBI:132615) has parent hydride friedelane (CHEBI:71575) |
| salaspermic acid (CHEBI:66153) has parent hydride friedelane (CHEBI:71575) |
| wilforic acid C (CHEBI:132375) has parent hydride friedelane (CHEBI:71575) |
| IUPAC Name |
|---|
| (4aR,6aR,6bS,8aR,9S,12aR,12bS,14aS,14bR)-2,2,4a,6a,8a,9,12b,14a-octamethyldocosahydropicene |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2055185 | Reaxys |
| Citations |
|---|