EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H48O5 |
| Net Charge | 0 |
| Average Mass | 488.709 |
| Monoisotopic Mass | 488.35017 |
| SMILES | [H][C@]12CC[C@@]34CO[C@@](O)([C@H](O)C[C@@]3([H])[C@]1(C)CC[C@@]1(C)[C@]3([H])C[C@](C)(C(=O)O)CC[C@]3(C)CC[C@]21C)[C@@H]4C |
| InChI | InChI=1S/C30H48O5/c1-18-29-8-7-19-26(4,20(29)15-22(31)30(18,34)35-17-29)12-14-28(6)21-16-25(3,23(32)33)10-9-24(21,2)11-13-27(19,28)5/h18-22,31,34H,7-17H2,1-6H3,(H,32,33)/t18-,19+,20+,21-,22-,24-,25-,26-,27-,28+,29+,30-/m1/s1 |
| InChIKey | JPAXVSRGFJVPEU-XCIUXINDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Tripterygium wilfordii (ncbitaxon:458696) | bark (BTO:0001301) | PubMed (2534610) | |
| Microtropis triflora (ncbitaxon:1089421) | - | PubMed (17972583) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| orthosphenic acid (CHEBI:132615) has parent hydride friedelane (CHEBI:71575) |
| orthosphenic acid (CHEBI:132615) is a cyclic hemiketal (CHEBI:59780) |
| orthosphenic acid (CHEBI:132615) is a diol (CHEBI:23824) |
| orthosphenic acid (CHEBI:132615) is a hexacyclic triterpenoid (CHEBI:70994) |
| orthosphenic acid (CHEBI:132615) is a hydroxy monocarboxylic acid (CHEBI:35868) |
| IUPAC Name |
|---|
| (2R,3R,5aR,7aS,7bR,9aS,12R,13aR,13bS,15aR,15bS,16R)-2,3-dihydroxy-7b,9a,12,13b,15a,16-hexamethylicosahydro-5H-3,5a-methanochryseno[2,1-c]oxepine-12-carboxylic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7836089 | Reaxys |
| CAS:86632-20-4 | ChemIDplus |
| Citations |
|---|