EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H48O4 |
| Net Charge | 0 |
| Average Mass | 472.710 |
| Monoisotopic Mass | 472.35526 |
| SMILES | [H][C@]12CC[C@]3(C)[C@@H](C)C(=O)[C@H](O)C[C@@]3([H])[C@]1(C)CC[C@@]1(C)[C@]3([H])C[C@](C)(C(=O)O)CC[C@]3(C)CC[C@]21C |
| InChI | InChI=1S/C30H48O4/c1-18-23(32)19(31)16-21-27(18,4)9-8-20-28(21,5)13-15-30(7)22-17-26(3,24(33)34)11-10-25(22,2)12-14-29(20,30)6/h18-22,31H,8-17H2,1-7H3,(H,33,34)/t18-,19+,20-,21+,22+,25+,26+,27+,28+,29+,30-/m0/s1 |
| InChIKey | KVLFXTHBJNNYDP-KWDXJSKJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Tripterygium doianum (ncbitaxon:859951) | - | Article (Phytochem., 61, (2002), 93) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| wilforic acid C (CHEBI:132375) has parent hydride friedelane (CHEBI:71575) |
| wilforic acid C (CHEBI:132375) has role plant metabolite (CHEBI:76924) |
| wilforic acid C (CHEBI:132375) is a cyclic terpene ketone (CHEBI:36130) |
| wilforic acid C (CHEBI:132375) is a hydroxy monocarboxylic acid (CHEBI:35868) |
| wilforic acid C (CHEBI:132375) is a pentacyclic triterpenoid (CHEBI:25872) |
| wilforic acid C (CHEBI:132375) is a secondary α-hydroxy ketone (CHEBI:2468) |
| IUPAC Name |
|---|
| (2R,4aS,6aR,6bS,8aS,9R,11R,12aS,12bS,14aS,14bR)-11-hydroxy-2,4a,6a,8a,9,12b,14a-heptamethyl-10-oxodocosahydropicene-2-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| C00038014 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7779868 | Reaxys |
| CAS:158629-70-0 | KNApSAcK |