EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H48O4 |
| Net Charge | 0 |
| Average Mass | 472.710 |
| Monoisotopic Mass | 472.35526 |
| SMILES | [H][C@]12CC[C@@]34CO[C@@](O)(CC[C@@]3([H])[C@]1(C)CC[C@@]1(C)[C@]3([H])C[C@](C)(C(=O)O)CC[C@]3(C)CC[C@]21C)[C@@H]4C |
| InChI | InChI=1S/C30H48O4/c1-19-29-9-7-20-26(4,21(29)8-10-30(19,33)34-18-29)14-16-28(6)22-17-25(3,23(31)32)12-11-24(22,2)13-15-27(20,28)5/h19-22,33H,7-18H2,1-6H3,(H,31,32)/t19-,20+,21+,22-,24-,25-,26-,27-,28+,29+,30+/m1/s1 |
| InChIKey | ZXENWDWQTWYUGY-UUZWCOCASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Salacia macrosperma (IPNI:162634-1) | - | DOI (10.1039/P19790000349) | |
| Tripterygium wilfordii (ncbitaxon:458696) | root (BTO:0001188) | PubMed (1375626) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. HIV-1 reverse transcriptase inhibitor An entity which inhibits the activity of HIV-1 reverse transcriptase. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| salaspermic acid (CHEBI:66153) has parent hydride friedelane (CHEBI:71575) |
| salaspermic acid (CHEBI:66153) has role HIV-1 reverse transcriptase inhibitor (CHEBI:53756) |
| salaspermic acid (CHEBI:66153) has role metabolite (CHEBI:25212) |
| salaspermic acid (CHEBI:66153) is a cyclic hemiketal (CHEBI:59780) |
| salaspermic acid (CHEBI:66153) is a hexacyclic triterpenoid (CHEBI:70994) |
| salaspermic acid (CHEBI:66153) is a hydroxy monocarboxylic acid (CHEBI:35868) |
| IUPAC Name |
|---|
| (3S,5aR,7aS,7bR,9aS,12R,13aR,13bS,15aR,15bS,16R)-3-hydroxy-7b,9a,12,13b,15a,16-hexamethylicosahydro-3,5a-methanochryseno[2,1-c]oxepine-12(5H)-carboxylic acid |
| Synonym | Source |
|---|---|
| (3β,20α)-3,24-epoxy-3-hydroxy-D:A-friedooleanan-29-oic acid | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4889115 | Reaxys |
| CAS:71247-78-4 | ChemIDplus |
| Citations |
|---|