EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | 2C25H23FNO4.Ca |
| Net Charge | 0 |
| Average Mass | 880.998 |
| Monoisotopic Mass | 880.28481 |
| SMILES | O=C([O-])C[C@H](O)C[C@H](O)/C=C/c1c(C2CC2)nc2ccccc2c1-c1ccc(F)cc1.O=C([O-])C[C@H](O)C[C@H](O)/C=C/c1c(C2CC2)nc2ccccc2c1-c1ccc(F)cc1.[Ca+2] |
| InChI | InChI=1S/2C25H24FNO4.Ca/c2*26-17-9-7-15(8-10-17)24-20-3-1-2-4-22(20)27-25(16-5-6-16)21(24)12-11-18(28)13-19(29)14-23(30)31;/h2*1-4,7-12,16,18-19,28-29H,5-6,13-14H2,(H,30,31);/q;;+2/p-2/b2*12-11+;/t2*18-,19-;/m11./s1 |
| InChIKey | RHGYHLPFVJEAOC-FFNUKLMVSA-L |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Role: | EC 1.1.1.34/EC 1.1.1.88 (hydroxymethylglutaryl-CoA reductase) inhibitor Any EC 1.1.1.* (oxidoreductase acting on donor CH-OH group, NAD+ or NADP+ acceptor) inhibitor that inhibits HMG-CoA reductases. Hydroxymethylglutaryl-CoA reductase inhibitors have been shown to lower directly cholesterol synthesis. The Enzyme Commission designation is EC 1.1.1.34 for the NADPH-dependent enzyme and EC 1.1.1.88 for an NADH-dependent enzyme. |
| Application: | anticholesteremic drug A substance used to lower plasma cholesterol levels. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pitavastatin calcium (CHEBI:71258) has part pitavastatin(1−) (CHEBI:71260) |
| pitavastatin calcium (CHEBI:71258) has role antioxidant (CHEBI:22586) |
| pitavastatin calcium (CHEBI:71258) is a calcium salt (CHEBI:35156) |
| pitavastatin calcium (CHEBI:71258) is a statin (synthetic) (CHEBI:87635) |
| IUPAC Name |
|---|
| calcium bis{(3R,5S,6E)-7-[2-cyclopropyl-4-(4-fluorophenyl)quinolin-3-yl]-3,5-dihydroxyhept-6-enoate} |
| Synonyms | Source |
|---|---|
| Bis((3R,5S,6E)-7-(2-cyclopropyl-4-(4-fluorophenyl)-3-quinolyl)-3,5-dihydroxy-6-heptenoate) monocalcium salt | ChemIDplus |
| Pitavastatin hemicalcium | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| D01862 | KEGG DRUG |
| EP2383260 | Patent |
| KR20110092804 | Patent |
| KR20110097058 | Patent |
| Pitavastatin | Wikipedia |
| US2009182008 | Patent |
| US2011082298 | Patent |
| US2011319624 | Patent |
| US2012016129 | Patent |
| US2012101126 | Patent |
| WO2005063711 | Patent |
| WO2007125547 | Patent |
| WO2007132482 | Patent |
| WO2011105649 | Patent |
| WO2012002741 | Patent |
| WO2012025939 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7965530 | Reaxys |
| CAS:147526-32-7 | ChemIDplus |
| CAS:147526-32-7 | KEGG DRUG |
| Citations |
|---|