EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H23FNO4 |
| Net Charge | -1 |
| Average Mass | 420.460 |
| Monoisotopic Mass | 420.16166 |
| SMILES | O=C([O-])C[C@H](O)C[C@H](O)/C=C/c1c(C2CC2)nc2ccccc2c1-c1ccc(F)cc1 |
| InChI | InChI=1S/C25H24FNO4/c26-17-9-7-15(8-10-17)24-20-3-1-2-4-22(20)27-25(16-5-6-16)21(24)12-11-18(28)13-19(29)14-23(30)31/h1-4,7-12,16,18-19,28-29H,5-6,13-14H2,(H,30,31)/p-1/b12-11+/t18-,19-/m1/s1 |
| InChIKey | VGYFMXBACGZSIL-MCBHFWOFSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pitavastatin(1−) (CHEBI:71260) is a hydroxy monocarboxylic acid anion (CHEBI:36059) |
| pitavastatin(1−) (CHEBI:71260) is conjugate base of pitavastatin (CHEBI:32020) |
| Incoming Relation(s) |
| pitavastatin calcium (CHEBI:71258) has part pitavastatin(1−) (CHEBI:71260) |
| pitavastatin (CHEBI:32020) is conjugate acid of pitavastatin(1−) (CHEBI:71260) |
| IUPAC Name |
|---|
| (3R,5S,6E)-7-[2-cyclopropyl-4-(4-fluorophenyl)quinolin-3-yl]-3,5-dihydroxyhept-6-enoate |
| Synonyms | Source |
|---|---|
| pitavastatin cation | ChEBI |
| (3R,5S,E)-7-(2-cyclopropyl-4-(4-fluorophenyl)quinolin-3-yl)-3,5-dihydroxyhept-6-enoate | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C13334 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7952950 | Reaxys |
| CAS:147511-69-1 | KEGG COMPOUND |