EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H16O4 |
| Net Charge | 0 |
| Average Mass | 272.300 |
| Monoisotopic Mass | 272.10486 |
| SMILES | COc1cc(O)c(C(=O)CCc2ccccc2)c(O)c1 |
| InChI | InChI=1S/C16H16O4/c1-20-12-9-14(18)16(15(19)10-12)13(17)8-7-11-5-3-2-4-6-11/h2-6,9-10,18-19H,7-8H2,1H3 |
| InChIKey | MDMCODCJMHTFIZ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | radical scavenger A role played by a substance that can react readily with, and thereby eliminate, radicals. |
| Biological Role: | antiplasmodial drug An antiparasitic drug which is effective against Apicomplexan parasites in the genus Plasmodium. The genus contains over 200 species and includes those responsible for malaria. |
| Application: | antiplasmodial drug An antiparasitic drug which is effective against Apicomplexan parasites in the genus Plasmodium. The genus contains over 200 species and includes those responsible for malaria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2',6'-dihydroxy-4'-methoxydihydrochalcone (CHEBI:28523) has functional parent dihydrochalcone (CHEBI:71231) |
| 2',6'-dihydroxy-4'-methoxydihydrochalcone (CHEBI:28523) has role antiplasmodial drug (CHEBI:64915) |
| 2',6'-dihydroxy-4'-methoxydihydrochalcone (CHEBI:28523) has role radical scavenger (CHEBI:48578) |
| 2',6'-dihydroxy-4'-methoxydihydrochalcone (CHEBI:28523) is a dihydrochalcones (CHEBI:71230) |
| 2',6'-dihydroxy-4'-methoxydihydrochalcone (CHEBI:28523) is a monomethoxybenzene (CHEBI:25235) |
| 2',6'-dihydroxy-4'-methoxydihydrochalcone (CHEBI:28523) is a polyphenol (CHEBI:26195) |
| IUPAC Name |
|---|
| 1-(2,6-dihydroxy-4-methoxyphenyl)-3-phenylpropan-1-one |
| Synonym | Source |
|---|---|
| 2',6'-Dihydroxy-4'-methoxydihydrochalcone | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C00007929 | KNApSAcK |
| C09644 | KEGG COMPOUND |
| HMDB0034435 | HMDB |
| LMPK12120511 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2468981 | Reaxys |
| CAS:35241-55-5 | ChemIDplus |
| CAS:35241-55-5 | KEGG COMPOUND |
| Citations |
|---|