EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H14O4 |
| Net Charge | 0 |
| Average Mass | 258.273 |
| Monoisotopic Mass | 258.08921 |
| SMILES | O=C(CCc1ccc(O)cc1)c1ccc(O)cc1O |
| InChI | InChI=1S/C15H14O4/c16-11-4-1-10(2-5-11)3-8-14(18)13-7-6-12(17)9-15(13)19/h1-2,4-7,9,16-17,19H,3,8H2 |
| InChIKey | UDGKKUWYNITJRX-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | anti-allergic agent A drug used to treat allergic reactions. anti-asthmatic agent Any compound that has anti-asthmatic effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| davidigenin (CHEBI:27655) has functional parent dihydrochalcone (CHEBI:71231) |
| davidigenin (CHEBI:27655) has role anti-allergic agent (CHEBI:50857) |
| davidigenin (CHEBI:27655) has role anti-asthmatic agent (CHEBI:65023) |
| davidigenin (CHEBI:27655) has role antioxidant (CHEBI:22586) |
| davidigenin (CHEBI:27655) has role metabolite (CHEBI:25212) |
| davidigenin (CHEBI:27655) is a dihydrochalcones (CHEBI:71230) |
| davidigenin (CHEBI:27655) is a polyphenol (CHEBI:26195) |
| IUPAC Name |
|---|
| 1-(2,4-dihydroxyphenyl)-3-(4-hydroxyphenyl)propan-1-one |
| Synonyms | Source |
|---|---|
| Davidigenin | KEGG COMPOUND |
| 4,2',4'-Trihydroxydihydrochalcone | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C09618 | KEGG COMPOUND |
| LMPK12120452 | LIPID MAPS |
| CN101022818 | Patent |
| C00007926 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1982275 | Reaxys |
| CAS:23130-26-9 | KEGG COMPOUND |
| Citations |
|---|