EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H27NO6 |
| Net Charge | 0 |
| Average Mass | 425.481 |
| Monoisotopic Mass | 425.18384 |
| SMILES | [H][C@]12CC[C@@]3(C=CC(=O)[C@@](C)(CCC(=O)Nc4c(O)ccc(C(=O)O)c4O)[C@]3([H])C1)CC2=C |
| InChI | InChI=1S/C24H27NO6/c1-13-12-24-9-5-14(13)11-17(24)23(2,18(27)6-10-24)8-7-19(28)25-20-16(26)4-3-15(21(20)29)22(30)31/h3-4,6,10,14,17,26,29H,1,5,7-9,11-12H2,2H3,(H,25,28)(H,30,31)/t14-,17-,23-,24+/m0/s1 |
| InChIKey | DWUHGPPFFABTIY-RLWZQHMASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces platensis (ncbitaxon:58346) | - | PubMed (21214253) | Strain: MA7327 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | EC 2.3.1.85 (fatty acid synthase) inhibitor An EC 2.3.1.* (acyltransferase transferring other than amino-acyl group) inhibitor that interferes with the action of fatty acid synthase (EC 2.3.1.85), a multi-enzyme protein involved in fatty acid synthesis. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| platencin (CHEBI:68241) has role antibacterial agent (CHEBI:33282) |
| platencin (CHEBI:68241) has role antimicrobial agent (CHEBI:33281) |
| platencin (CHEBI:68241) has role bacterial metabolite (CHEBI:76969) |
| platencin (CHEBI:68241) has role EC 2.3.1.85 (fatty acid synthase) inhibitor (CHEBI:71476) |
| platencin (CHEBI:68241) is a aromatic amide (CHEBI:62733) |
| platencin (CHEBI:68241) is a cyclic ketone (CHEBI:3992) |
| platencin (CHEBI:68241) is a dihydroxybenzoic acid (CHEBI:23778) |
| platencin (CHEBI:68241) is a monocarboxylic acid amide (CHEBI:29347) |
| platencin (CHEBI:68241) is a polycyclic cage (CHEBI:33640) |
| platencin (CHEBI:68241) is conjugate acid of platencin(1−) (CHEBI:178056) |
| Incoming Relation(s) |
| platencin A1 (CHEBI:68249) has functional parent platencin (CHEBI:68241) |
| platencin A2 (CHEBI:68251) has functional parent platencin (CHEBI:68241) |
| platencin A3 (CHEBI:68253) has functional parent platencin (CHEBI:68241) |
| platensin A4 (CHEBI:68255) has functional parent platencin (CHEBI:68241) |
| platencin(1−) (CHEBI:178056) is conjugate base of platencin (CHEBI:68241) |
| IUPAC Name |
|---|
| 2,4-dihydroxy-3-({3-[(4aS,8S,8aR)-8-methyl-3-methylidene-7-oxo-1,3,4,7,8,8a-hexahydro-2H-2,4a-ethanonaphthalen-8-yl]propanoyl}amino)benzoic acid |
| Synonym | Source |
|---|---|
| (−)-platencin | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11140608 | Reaxys |
| CAS:869898-86-2 | ChemIDplus |
| Citations |
|---|