EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H29NO7 |
| Net Charge | 0 |
| Average Mass | 443.496 |
| Monoisotopic Mass | 443.19440 |
| SMILES | [H][C@]12CC[C@@]3(C=CC(=O)[C@@](C)(CCC(=O)Nc4c(O)ccc(C(=O)O)c4O)[C@]3([H])C1)C[C@@]2(C)O |
| InChI | InChI=1S/C24H29NO7/c1-22(8-7-18(28)25-19-15(26)4-3-14(20(19)29)21(30)31)16-11-13-5-9-24(16,10-6-17(22)27)12-23(13,2)32/h3-4,6,10,13,16,26,29,32H,5,7-9,11-12H2,1-2H3,(H,25,28)(H,30,31)/t13-,16-,22-,23+,24+/m0/s1 |
| InChIKey | PNAZDWJMYGFNNJ-NAXDPANMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces platensis (ncbitaxon:58346) | - | PubMed (21214253) | Strain: MA7327 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| platensin A4 (CHEBI:68255) has functional parent platencin (CHEBI:68241) |
| platensin A4 (CHEBI:68255) has role bacterial metabolite (CHEBI:76969) |
| platensin A4 (CHEBI:68255) is a aromatic amide (CHEBI:62733) |
| platensin A4 (CHEBI:68255) is a cyclic ketone (CHEBI:3992) |
| platensin A4 (CHEBI:68255) is a dihydroxybenzoic acid (CHEBI:23778) |
| platensin A4 (CHEBI:68255) is a monocarboxylic acid amide (CHEBI:29347) |
| platensin A4 (CHEBI:68255) is a polycyclic cage (CHEBI:33640) |
| platensin A4 (CHEBI:68255) is a tertiary alcohol (CHEBI:26878) |
| IUPAC Name |
|---|
| 2,4-dihydroxy-3-({3-[(2S,3R,4aS,8S,8aR)-3-hydroxy-3,8-dimethyl-7-oxo-1,3,4,7,8,8a-hexahydro-2H-2,4a-ethanonaphthalen-8-yl]propanoyl}amino)benzoic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:20323714 | Reaxys |
| Citations |
|---|