EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H27NO7 |
| Net Charge | 0 |
| Average Mass | 441.480 |
| Monoisotopic Mass | 441.17875 |
| SMILES | [H][C@]12C[C@@H](O)[C@@]3(C=CC(=O)[C@@](C)(CCC(=O)Nc4c(O)ccc(C(=O)O)c4O)[C@]3([H])C1)CC2=C |
| InChI | InChI=1S/C24H27NO7/c1-12-11-24-8-5-17(27)23(2,16(24)9-13(12)10-18(24)28)7-6-19(29)25-20-15(26)4-3-14(21(20)30)22(31)32/h3-5,8,13,16,18,26,28,30H,1,6-7,9-11H2,2H3,(H,25,29)(H,31,32)/t13-,16+,18-,23+,24+/m1/s1 |
| InChIKey | KCPPASJQWABQQM-XLJNEENLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces platensis (ncbitaxon:58346) | - | PubMed (21214253) | Strain: MA7327 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| platencin A1 (CHEBI:68249) has functional parent platencin (CHEBI:68241) |
| platencin A1 (CHEBI:68249) has role bacterial metabolite (CHEBI:76969) |
| platencin A1 (CHEBI:68249) is a aromatic amide (CHEBI:62733) |
| platencin A1 (CHEBI:68249) is a cyclic ketone (CHEBI:3992) |
| platencin A1 (CHEBI:68249) is a dihydroxybenzoic acid (CHEBI:23778) |
| platencin A1 (CHEBI:68249) is a monocarboxylic acid amide (CHEBI:29347) |
| platencin A1 (CHEBI:68249) is a polycyclic cage (CHEBI:33640) |
| platencin A1 (CHEBI:68249) is a secondary alcohol (CHEBI:35681) |
| Incoming Relation(s) |
| platencin A1 methyl ester (CHEBI:68250) has functional parent platencin A1 (CHEBI:68249) |
| IUPAC Name |
|---|
| 2,4-dihydroxy-3-({3-[(2R,4aR,8S,8aR,9R)-9-hydroxy-8-methyl-3-methylidene-7-oxo-1,3,4,7,8,8a-hexahydro-2H-2,4a-ethanonaphthalen-8-yl]propanoyl}amino)benzoic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:20696045 | Reaxys |
| Citations |
|---|