EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H26NO6 |
| Net Charge | -1 |
| Average Mass | 424.473 |
| Monoisotopic Mass | 424.17656 |
| SMILES | [H][C@]12CC[C@@]3(C=CC(=O)[C@@](C)(CCC(=O)Nc4c(O)ccc(C(=O)[O-])c4O)[C@]3([H])C1)CC2=C |
| InChI | InChI=1S/C24H27NO6/c1-13-12-24-9-5-14(13)11-17(24)23(2,18(27)6-10-24)8-7-19(28)25-20-16(26)4-3-15(21(20)29)22(30)31/h3-4,6,10,14,17,26,29H,1,5,7-9,11-12H2,2H3,(H,25,28)(H,30,31)/p-1/t14-,17-,23-,24+/m0/s1 |
| InChIKey | DWUHGPPFFABTIY-RLWZQHMASA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| platencin(1−) (CHEBI:178056) is a dihydroxybenzoate (CHEBI:36084) |
| platencin(1−) (CHEBI:178056) is a monocarboxylic acid anion (CHEBI:35757) |
| platencin(1−) (CHEBI:178056) is conjugate base of platencin (CHEBI:68241) |
| Incoming Relation(s) |
| platencin (CHEBI:68241) is conjugate acid of platencin(1−) (CHEBI:178056) |
| IUPAC Name |
|---|
| 2,4-dihydroxy-3-{3-[(4aS,8S,8aR)-8-methyl-3-methylidene-7-oxo-1,3,4,7,8,8a-hexahydro-2H-2,4a-ethanonaphthalen-8-yl]propanamido}benzoate |
| Synonyms | Source |
|---|---|
| (−)-platencin anion | ChEBI |
| platencin anion | ChEBI |
| UniProt Name | Source |
|---|---|
| platencin | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-23571 | MetaCyc |
| Citations |
|---|