EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:6809 - methamphetamine
| Formula | C10H15N |
| Net Charge | 0 |
| Average Mass | 149.237 |
| Monoisotopic Mass | 149.12045 |
| SMILES | CN[C@@H](C)Cc1ccccc1 |
| InChI | InChI=1S/C10H15N/c1-9(11-2)8-10-6-4-3-5-7-10/h3-7,9,11H,8H2,1-2H3/t9-/m0/s1 |
| InChIKey | MYWUZJCMWCOHBA-VIFPVBQESA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. neurotoxin A poison that interferes with the functions of the nervous system. |
| Applications: | central nervous system stimulant Any drug that enhances the activity of the central nervous system. psychotropic drug A loosely defined grouping of drugs that have effects on psychological function. central nervous system stimulant Any drug that enhances the activity of the central nervous system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| methamphetamine (CHEBI:6809) has functional parent (S)-amphetamine (CHEBI:4469) |
| methamphetamine (CHEBI:6809) has role central nervous system stimulant (CHEBI:35337) |
| methamphetamine (CHEBI:6809) has role environmental contaminant (CHEBI:78298) |
| methamphetamine (CHEBI:6809) has role neurotoxin (CHEBI:50910) |
| methamphetamine (CHEBI:6809) has role psychotropic drug (CHEBI:35471) |
| methamphetamine (CHEBI:6809) has role xenobiotic (CHEBI:35703) |
| methamphetamine (CHEBI:6809) is a amphetamines (CHEBI:35338) |
| methamphetamine (CHEBI:6809) is a secondary amine (CHEBI:32863) |
| methamphetamine (CHEBI:6809) is conjugate base of methamphetamine(1+) (CHEBI:132297) |
| Incoming Relation(s) |
| (S)-(+)-4-(5-carboxypentyl)methamphetamine (CHEBI:67238) has functional parent methamphetamine (CHEBI:6809) |
| N-(4-aminobutyl)-D-methamphetamine (CHEBI:235379) has functional parent methamphetamine (CHEBI:6809) |
| 4-hydroxymethamphetamine (CHEBI:76833) has functional parent methamphetamine (CHEBI:6809) |
| methamphetamine(1+) (CHEBI:132297) is conjugate acid of methamphetamine (CHEBI:6809) |
| IUPAC Name |
|---|
| (2S)-N-methyl-1-phenylpropan-2-amine |
| INNs | Source |
|---|---|
| metamfetamine | WHO MedNet |
| métamfétamine | WHO MedNet |
| metamfetaminum | WHO MedNet |
| metanfetamina | WHO MedNet |
| Synonyms | Source |
|---|---|
| dextromethamphetamine | ChEBI |
| d-1-phenyl-2-methylaminopropane | ChemIDplus |
| d-deoxyephedrine | ChemIDplus |
| d-desoxyephedrine | ChemIDplus |
| d-N-methylamphetamine | ChemIDplus |
| d-phenylisopropylmethylamine | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 1732 | DrugCentral |
| B40 | PDBeChem |
| C07164 | KEGG COMPOUND |
| D08187 | KEGG DRUG |
| DB01577 | DrugBank |
| HMDB0015517 | HMDB |
| Methamphetamine | Wikipedia |
| Citations |
|---|