EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:6809 - methamphetamine
| Formula | C10H15N |
| Net Charge | 0 |
| Average Mass | 149.237 |
| Monoisotopic Mass | 149.12045 |
| SMILES | CN[C@@H](C)Cc1ccccc1 |
| InChI | InChI=1S/C10H15N/c1-9(11-2)8-10-6-4-3-5-7-10/h3-7,9,11H,8H2,1-2H3/t9-/m0/s1 |
| InChIKey | MYWUZJCMWCOHBA-VIFPVBQESA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | neurotoxin A poison that interferes with the functions of the nervous system. xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| Applications: | psychotropic drug A loosely defined grouping of drugs that have effects on psychological function. central nervous system stimulant Any drug that enhances the activity of the central nervous system. central nervous system stimulant Any drug that enhances the activity of the central nervous system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| methamphetamine (CHEBI:6809) has functional parent (S)-amphetamine (CHEBI:4469) |
| methamphetamine (CHEBI:6809) has role central nervous system stimulant (CHEBI:35337) |
| methamphetamine (CHEBI:6809) has role environmental contaminant (CHEBI:78298) |
| methamphetamine (CHEBI:6809) has role neurotoxin (CHEBI:50910) |
| methamphetamine (CHEBI:6809) has role psychotropic drug (CHEBI:35471) |
| methamphetamine (CHEBI:6809) has role xenobiotic (CHEBI:35703) |
| methamphetamine (CHEBI:6809) is a amphetamines (CHEBI:35338) |
| methamphetamine (CHEBI:6809) is a secondary amine (CHEBI:32863) |
| methamphetamine (CHEBI:6809) is conjugate base of methamphetamine(1+) (CHEBI:132297) |
| Incoming Relation(s) |
| (S)-(+)-4-(5-carboxypentyl)methamphetamine (CHEBI:67238) has functional parent methamphetamine (CHEBI:6809) |
| N-(4-aminobutyl)-D-methamphetamine (CHEBI:235379) has functional parent methamphetamine (CHEBI:6809) |
| 4-hydroxymethamphetamine (CHEBI:76833) has functional parent methamphetamine (CHEBI:6809) |
| methamphetamine(1+) (CHEBI:132297) is conjugate acid of methamphetamine (CHEBI:6809) |
| IUPAC Name |
|---|
| (2S)-N-methyl-1-phenylpropan-2-amine |
| INNs | Source |
|---|---|
| metanfetamina | WHO MedNet |
| metamfetamine | WHO MedNet |
| metamfetaminum | WHO MedNet |
| métamfétamine | WHO MedNet |
| Synonyms | Source |
|---|---|
| Methamphetamine | KEGG COMPOUND |
| (S)-N,α-dimethylbenzeneethanamine | ChemIDplus |
| (+)-(S)-N-α-dimethylphenethylamine | NIST Chemistry WebBook |
| methyl-β-phenylisopropylamine | NIST Chemistry WebBook |
| d-deoxyephedrine | ChemIDplus |
| d-desoxyephedrine | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C07164 | KEGG COMPOUND |
| Methamphetamine | Wikipedia |
| DB01577 | DrugBank |
| B40 | PDBeChem |
| HMDB0015517 | HMDB |
| D08187 | KEGG DRUG |
| 1732 | DrugCentral |
| Citations |
|---|