EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H24N2 |
| Net Charge | 0 |
| Average Mass | 220.360 |
| Monoisotopic Mass | 220.19395 |
| SMILES | C[C@@H](Cc1ccccc1)N(C)CCCCN |
| InChI | InChI=1S/C14H24N2/c1-13(16(2)11-7-6-10-15)12-14-8-4-3-5-9-14/h3-5,8-9,13H,6-7,10-12,15H2,1-2H3/t13-/m0/s1 |
| InChIKey | VATIIUARCMKQBJ-ZDUSSCGKSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | hapten Any substance capable of eliciting an immune response only when attached to a large carrier such as a protein. Examples include dinitrophenols; oligosaccharides; peptides; and heavy metals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-(4-aminobutyl)-D-methamphetamine (CHEBI:235379) has functional parent methamphetamine (CHEBI:6809) |
| N-(4-aminobutyl)-D-methamphetamine (CHEBI:235379) is a N-(4-aminobutyl)methamphetamine (CHEBI:235381) |
| N-(4-aminobutyl)-D-methamphetamine (CHEBI:235379) is enantiomer of N-(4-aminobutyl)-L-methamphetamine (CHEBI:235380) |
| Incoming Relation(s) |
| N-(4-aminobutyl)-DL-methamphetamine (CHEBI:235325) has part N-(4-aminobutyl)-D-methamphetamine (CHEBI:235379) |
| N-(4-aminobutyl)-L-methamphetamine (CHEBI:235380) is enantiomer of N-(4-aminobutyl)-D-methamphetamine (CHEBI:235379) |
| IUPAC Name |
|---|
| N-methyl-N-[(2S)-1-phenylpropan-2-yl]butane-1,4-diamine |
| Synonyms | Source |
|---|---|
| N-(4-aminobutyl)-d-methamphetamine | ChEBI |
| N1-methyl-N1-[(2S)-1-phenylpropan-2-yl]butane-1,4-diamine | IUPAC |
| Registry Numbers | Sources |
|---|---|
| CAS:78232-38-9 | ChEBI |