EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H25NO2 |
| Net Charge | 0 |
| Average Mass | 263.381 |
| Monoisotopic Mass | 263.18853 |
| SMILES | CN[C@@H](C)Cc1ccc(CCCCCC(=O)O)cc1 |
| InChI | InChI=1S/C16H25NO2/c1-13(17-2)12-15-10-8-14(9-11-15)6-4-3-5-7-16(18)19/h8-11,13,17H,3-7,12H2,1-2H3,(H,18,19)/t13-/m0/s1 |
| InChIKey | LRPWOTTUPMGYOO-ZDUSSCGKSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | hapten Any substance capable of eliciting an immune response only when attached to a large carrier such as a protein. Examples include dinitrophenols; oligosaccharides; peptides; and heavy metals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-(+)-4-(5-carboxypentyl)methamphetamine (CHEBI:67238) has functional parent hexanoic acid (CHEBI:30776) |
| (S)-(+)-4-(5-carboxypentyl)methamphetamine (CHEBI:67238) has functional parent methamphetamine (CHEBI:6809) |
| (S)-(+)-4-(5-carboxypentyl)methamphetamine (CHEBI:67238) has role hapten (CHEBI:59174) |
| (S)-(+)-4-(5-carboxypentyl)methamphetamine (CHEBI:67238) is a monocarboxylic acid (CHEBI:25384) |
| (S)-(+)-4-(5-carboxypentyl)methamphetamine (CHEBI:67238) is a secondary amino compound (CHEBI:50995) |
| IUPAC Name |
|---|
| 6-{4-[(2S)-2-(methylamino)propyl]phenyl}hexanoic acid |
| Synonyms | Source |
|---|---|
| (+)-4-(5-carboxypentyl)methamphetamine | ChEBI |
| (+)-METH-P6 | ChEBI |
| Citations |
|---|