EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H42O4 |
| Net Charge | 0 |
| Average Mass | 430.629 |
| Monoisotopic Mass | 430.30831 |
| SMILES | [H][C@]12C[C@@H](OC(C)=O)[C@@]3(C)[C@@]([H])(CC=C4CO[C@@H](O)[C@@]43[H])[C@]1(C)CC[C@@]1([H])C(C)(C)CCC[C@]21C |
| InChI | InChI=1S/C27H42O4/c1-16(28)31-21-14-20-25(4)12-7-11-24(2,3)18(25)10-13-26(20,5)19-9-8-17-15-30-23(29)22(17)27(19,21)6/h8,18-23,29H,7,9-15H2,1-6H3/t18-,19-,20+,21+,22+,23+,25-,26-,27+/m0/s1 |
| InChIKey | IDZDIJBVDDHIIM-MWZFGUNWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Hyattella (ncbitaxon:436463) | - | PubMed (21341710) | Frozen, lyophilized, macerated specimens were repeatedly extracted with CH2Cl2 and MeOH |
| Roles Classification |
|---|
| Biological Role: | animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 12-epi-deoxoscalarin (CHEBI:68041) has functional parent 12-epi-scalarin (CHEBI:519990) |
| 12-epi-deoxoscalarin (CHEBI:68041) has role animal metabolite (CHEBI:75767) |
| 12-epi-deoxoscalarin (CHEBI:68041) is a acetate ester (CHEBI:47622) |
| 12-epi-deoxoscalarin (CHEBI:68041) is a organic heteropentacyclic compound (CHEBI:38164) |
| 12-epi-deoxoscalarin (CHEBI:68041) is a scalarane sesterterpenoid (CHEBI:59370) |
| Incoming Relation(s) |
| 12-epi-19-O-methyldeoxoscalarin (CHEBI:68044) has functional parent 12-epi-deoxoscalarin (CHEBI:68041) |
| 23-acetoxy-12-epi-deoxoscalarin (CHEBI:68042) has functional parent 12-epi-deoxoscalarin (CHEBI:68041) |
| IUPAC Name |
|---|
| (1R,5aS,5bR,7aS,11aS,11bR,13R,13aS,13bS)-1-hydroxy-5b,8,8,11a,13a-pentamethyl-1,3,5,5a,5b,6,7,7a,8,9,10,11,11a,11b,12,13,13a,13b-octadecahydrochryseno[1,2-c]furan-13-yl acetate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3040299 | Reaxys |
| Citations |
|---|