EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H44O6 |
| Net Charge | 0 |
| Average Mass | 488.665 |
| Monoisotopic Mass | 488.31379 |
| SMILES | [H][C@]12C[C@@H](OC(C)=O)[C@@]3(C)[C@@]([H])(CC=C4CO[C@@H](O)[C@@]43[H])[C@]1(C)CC[C@@]1([H])C(C)(C)CCC[C@]21COC(C)=O |
| InChI | InChI=1S/C29H44O6/c1-17(30)34-16-29-12-7-11-26(3,4)20(29)10-13-27(5)21-9-8-19-15-33-25(32)24(19)28(21,6)23(14-22(27)29)35-18(2)31/h8,20-25,32H,7,9-16H2,1-6H3/t20-,21-,22-,23+,24+,25+,27-,28+,29+/m0/s1 |
| InChIKey | KUKXABQOPRSQOW-IQVVWXMOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Hyattella (ncbitaxon:436463) | - | PubMed (21341710) | Frozen, lyophilized, macerated specimens were repeatedly extracted with CH2Cl2 and MeOH |
| Roles Classification |
|---|
| Biological Role: | animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 23-acetoxy-12-epi-deoxoscalarin (CHEBI:68042) has functional parent 12-epi-deoxoscalarin (CHEBI:68041) |
| 23-acetoxy-12-epi-deoxoscalarin (CHEBI:68042) has role animal metabolite (CHEBI:75767) |
| 23-acetoxy-12-epi-deoxoscalarin (CHEBI:68042) is a acetate ester (CHEBI:47622) |
| 23-acetoxy-12-epi-deoxoscalarin (CHEBI:68042) is a organic heteropentacyclic compound (CHEBI:38164) |
| 23-acetoxy-12-epi-deoxoscalarin (CHEBI:68042) is a scalarane sesterterpenoid (CHEBI:59370) |
| Incoming Relation(s) |
| 23-acetoxy-12-O-deacetyl-12-epi-deoxoscalarin (CHEBI:68043) has functional parent 23-acetoxy-12-epi-deoxoscalarin (CHEBI:68042) |
| IUPAC Name |
|---|
| rel[(1R,5aS,5bR,7aS,11aR,11bS,13R,13aS,13bS)-13-(acetyloxy)-1-hydroxy-5b,8,8,13a-tetramethyl-1,5,5a,5b,6,7,7a,8,9,10,11,11b,12,13,13a,13b-hexadecahydrochryseno[1,2-c]furan-11a(3H)-yl]methyl acetate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21448570 | Reaxys |
| Citations |
|---|