EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H40O5 |
| Net Charge | 0 |
| Average Mass | 444.612 |
| Monoisotopic Mass | 444.28757 |
| SMILES | [H][C@]12C[C@@H](OC(C)=O)[C@@]3(C)[C@@]([H])(CC=C4C(=O)O[C@@H](O)[C@@]43[H])[C@]1(C)CC[C@@]1([H])C(C)(C)CCC[C@]21C |
| InChI | InChI=1S/C27H40O5/c1-15(28)31-20-14-19-25(4)12-7-11-24(2,3)17(25)10-13-26(19,5)18-9-8-16-21(27(18,20)6)23(30)32-22(16)29/h8,17-21,23,30H,7,9-14H2,1-6H3/t17-,18-,19+,20+,21+,23+,25-,26-,27+/m0/s1 |
| InChIKey | VLFJWLVMFJQJEU-VUZQMFHASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Hyattella (ncbitaxon:436463) | - | PubMed (21341710) | Frozen, lyophilized, macerated specimens were repeatedly extracted with CH2Cl2 and MeOH |
| Roles Classification |
|---|
| Biological Role: | animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 12-epi-scalarin (CHEBI:519990) has role animal metabolite (CHEBI:75767) |
| 12-epi-scalarin (CHEBI:519990) is a scalarane sesterterpenoid (CHEBI:59370) |
| Incoming Relation(s) |
| 12-epi-19-O-methylscalarin (CHEBI:68037) has functional parent 12-epi-scalarin (CHEBI:519990) |
| 12-epi-deoxoscalarin (CHEBI:68041) has functional parent 12-epi-scalarin (CHEBI:519990) |
| 12-O-deacetyl-12-epi-19-deoxy-21-hydroxyscalarin (CHEBI:68038) has functional parent 12-epi-scalarin (CHEBI:519990) |
| 12-O-deacetyl-19-O-methyl-12-epi-deoxoscalarin (CHEBI:68040) has functional parent 12-epi-scalarin (CHEBI:519990) |
| IUPAC Name |
|---|
| (17a1R)-12β-acetoxy-17a1-hydroxy-4,4,8,17,17aβ-pentamethyl-17a-homo-5α-androst-16-ene-17,17a1-carbolactone |
| Synonym | Source |
|---|---|
| 12-epi-scalarin | ChEMBL |
| Citations |
|---|