EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H44O4 |
| Net Charge | 0 |
| Average Mass | 444.656 |
| Monoisotopic Mass | 444.32396 |
| SMILES | [H][C@]12C[C@@H](OC(C)=O)[C@@]3(C)[C@@]([H])(CC=C4CO[C@@H](OC)[C@@]43[H])[C@]1(C)CC[C@@]1([H])C(C)(C)CCC[C@]21C |
| InChI | InChI=1S/C28H44O4/c1-17(29)32-22-15-21-26(4)13-8-12-25(2,3)19(26)11-14-27(21,5)20-10-9-18-16-31-24(30-7)23(18)28(20,22)6/h9,19-24H,8,10-16H2,1-7H3/t19-,20-,21+,22+,23+,24+,26-,27-,28+/m0/s1 |
| InChIKey | MGLNUFHGBIDJLB-NWLMTDSXSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Hyattella (ncbitaxon:436463) | - | PubMed (21341710) | Frozen, lyophilized, macerated specimens were repeatedly extracted with CH2Cl2 and MeOH |
| Roles Classification |
|---|
| Biological Role: | animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 12-epi-19-O-methyldeoxoscalarin (CHEBI:68044) has functional parent 12-epi-deoxoscalarin (CHEBI:68041) |
| 12-epi-19-O-methyldeoxoscalarin (CHEBI:68044) has role animal metabolite (CHEBI:75767) |
| 12-epi-19-O-methyldeoxoscalarin (CHEBI:68044) is a acetate ester (CHEBI:47622) |
| 12-epi-19-O-methyldeoxoscalarin (CHEBI:68044) is a organic heteropentacyclic compound (CHEBI:38164) |
| 12-epi-19-O-methyldeoxoscalarin (CHEBI:68044) is a scalarane sesterterpenoid (CHEBI:59370) |
| IUPAC Name |
|---|
| rel-(1R,5aS,5bR,7aS,11aS,11bR,13R,13aS,13bS)-1-methoxy-5b,8,8,11a,13a-pentamethyl-1,3,5,5a,5b,6,7,7a,8,9,10,11,11a,11b,12,13,13a,13b-octadecahydrochryseno[1,2-c]furan-13-yl acetate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10613854 | Reaxys |
| Citations |
|---|