EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H24O6 |
| Net Charge | 0 |
| Average Mass | 360.406 |
| Monoisotopic Mass | 360.15729 |
| SMILES | COc1cc(C[C@H]2CO[C@H](c3ccc(O)c(OC)c3)[C@H]2CO)ccc1O |
| InChI | InChI=1S/C20H24O6/c1-24-18-8-12(3-5-16(18)22)7-14-11-26-20(15(14)10-21)13-4-6-17(23)19(9-13)25-2/h3-6,8-9,14-15,20-23H,7,10-11H2,1-2H3/t14-,15-,20+/m0/s1 |
| InChIKey | MHXCIKYXNYCMHY-AUSJPIAWSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Rubia yunnanensis (IPNI:765385-1) | root (BTO:0001188) | PubMed (21973054) | Methanolic extract of air dried powdered roots. |
| Taxus yunnanensis (ncbitaxon:147275) | xylem (BTO:0001468) | PubMed (21138310) | Previous component: wood; Aqueous extract of air-dried, powdered wood |
| Roles Classification |
|---|
| Biological Roles: | antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (+)-lariciresinol (CHEBI:67246) has role antifungal agent (CHEBI:35718) |
| (+)-lariciresinol (CHEBI:67246) has role plant metabolite (CHEBI:76924) |
| (+)-lariciresinol (CHEBI:67246) is a aromatic ether (CHEBI:35618) |
| (+)-lariciresinol (CHEBI:67246) is a lignan (CHEBI:25036) |
| (+)-lariciresinol (CHEBI:67246) is a oxolanes (CHEBI:26912) |
| (+)-lariciresinol (CHEBI:67246) is a phenols (CHEBI:33853) |
| (+)-lariciresinol (CHEBI:67246) is a primary alcohol (CHEBI:15734) |
| (+)-lariciresinol (CHEBI:67246) is enantiomer of (−)-lariciresinol (CHEBI:67244) |
| Incoming Relation(s) |
| (+)-(7S,8R,8'R)-5,5'-dimethoxylariciresinol (CHEBI:67650) has functional parent (+)-lariciresinol (CHEBI:67246) |
| (+)-5'-methoxylariciresinol (CHEBI:67651) has functional parent (+)-lariciresinol (CHEBI:67246) |
| (−)-lariciresinol (CHEBI:67244) is enantiomer of (+)-lariciresinol (CHEBI:67246) |
| IUPAC Name |
|---|
| 4-[(2S,3R,4R)-4-(4-hydroxy-3-methoxybenzyl)-3-(hydroxymethyl)tetrahydrofuran-2-yl]-2-methoxyphenol |
| Synonym | Source |
|---|---|
| Lariciresinol | ChemIDplus |
| UniProt Name | Source |
|---|---|
| (+)-lariciresinol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C00000602 | KNApSAcK |
| C10646 | KEGG COMPOUND |
| CPD-8907 | MetaCyc |
| Lariciresinol | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:27003-73-2 | KEGG COMPOUND |
| CAS:83327-19-9 | ChemIDplus |
| Citations |
|---|