EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H24O6 |
| Net Charge | 0 |
| Average Mass | 360.406 |
| Monoisotopic Mass | 360.15729 |
| SMILES | COc1cc(C[C@@H]2CO[C@@H](c3ccc(O)c(OC)c3)[C@@H]2CO)ccc1O |
| InChI | InChI=1S/C20H24O6/c1-24-18-8-12(3-5-16(18)22)7-14-11-26-20(15(14)10-21)13-4-6-17(23)19(9-13)25-2/h3-6,8-9,14-15,20-23H,7,10-11H2,1-2H3/t14-,15-,20+/m1/s1 |
| InChIKey | MHXCIKYXNYCMHY-SXGZJXTBSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (−)-lariciresinol (CHEBI:67244) is a lignan (CHEBI:25036) |
| (−)-lariciresinol (CHEBI:67244) is a oxolanes (CHEBI:26912) |
| (−)-lariciresinol (CHEBI:67244) is a phenols (CHEBI:33853) |
| (−)-lariciresinol (CHEBI:67244) is enantiomer of (+)-lariciresinol (CHEBI:67246) |
| Incoming Relation(s) |
| (+)-lariciresinol (CHEBI:67246) is enantiomer of (−)-lariciresinol (CHEBI:67244) |
| IUPAC Name |
|---|
| 4-[(2R,3S,4S)-4-(4-hydroxy-3-methoxybenzyl)-3-(hydroxymethyl)tetrahydrofuran-2-yl]-2-methoxyphenol |
| Synonym | Source |
|---|---|
| Lariciresinol | ChemIDplus |
| UniProt Name | Source |
|---|---|
| (−)-lariciresinol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-8908 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5622895 | Reaxys |
| CAS:83327-19-9 | ChemIDplus |
| Citations |
|---|