EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H26O7 |
| Net Charge | 0 |
| Average Mass | 390.432 |
| Monoisotopic Mass | 390.16785 |
| SMILES | COc1cc(C[C@H]2CO[C@H](c3cc(OC)c(O)c(OC)c3)[C@H]2CO)ccc1O |
| InChI | InChI=1S/C21H26O7/c1-25-17-7-12(4-5-16(17)23)6-14-11-28-21(15(14)10-22)13-8-18(26-2)20(24)19(9-13)27-3/h4-5,7-9,14-15,21-24H,6,10-11H2,1-3H3/t14-,15-,21+/m0/s1 |
| InChIKey | CRMXIJILTLLGMR-VFCRVFHLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sinocalamus affinis (IPNI:421970-1) | stem (BTO:0001300) | PubMed (21469695) | 95% Ethanolic extract of skin-removed, air-dried, powdered stems. |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (+)-5'-methoxylariciresinol (CHEBI:67651) has functional parent (+)-lariciresinol (CHEBI:67246) |
| (+)-5'-methoxylariciresinol (CHEBI:67651) has role plant metabolite (CHEBI:76924) |
| (+)-5'-methoxylariciresinol (CHEBI:67651) is a dimethoxybenzene (CHEBI:51681) |
| (+)-5'-methoxylariciresinol (CHEBI:67651) is a lignan (CHEBI:25036) |
| (+)-5'-methoxylariciresinol (CHEBI:67651) is a oxolanes (CHEBI:26912) |
| (+)-5'-methoxylariciresinol (CHEBI:67651) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| 4-[(2S,3R,4R)-4-(4-hydroxy-3-methoxybenzyl)-3-(hydroxymethyl)tetrahydrofuran-2-yl]-2,6-dimethoxyphenol |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9440218 | Reaxys |
| Citations |
|---|