EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H28O8 |
| Net Charge | 0 |
| Average Mass | 420.458 |
| Monoisotopic Mass | 420.17842 |
| SMILES | COc1cc(C[C@H]2CO[C@H](c3cc(OC)c(O)c(OC)c3)[C@H]2CO)cc(OC)c1O |
| InChI | InChI=1S/C22H28O8/c1-26-16-6-12(7-17(27-2)20(16)24)5-14-11-30-22(15(14)10-23)13-8-18(28-3)21(25)19(9-13)29-4/h6-9,14-15,22-25H,5,10-11H2,1-4H3/t14-,15-,22+/m0/s1 |
| InChIKey | HBBWYJVDBFYNOP-AYSMAOOMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sinocalamus affinis (IPNI:421970-1) | stem (BTO:0001300) | PubMed (21469695) | 95% Ethanolic extract of skin-removed, air-dried, powdered stems. |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (+)-(7S,8R,8'R)-5,5'-dimethoxylariciresinol (CHEBI:67650) has functional parent (+)-lariciresinol (CHEBI:67246) |
| (+)-(7S,8R,8'R)-5,5'-dimethoxylariciresinol (CHEBI:67650) has role plant metabolite (CHEBI:76924) |
| (+)-(7S,8R,8'R)-5,5'-dimethoxylariciresinol (CHEBI:67650) is a dimethoxybenzene (CHEBI:51681) |
| (+)-(7S,8R,8'R)-5,5'-dimethoxylariciresinol (CHEBI:67650) is a lignan (CHEBI:25036) |
| (+)-(7S,8R,8'R)-5,5'-dimethoxylariciresinol (CHEBI:67650) is a oxolanes (CHEBI:26912) |
| (+)-(7S,8R,8'R)-5,5'-dimethoxylariciresinol (CHEBI:67650) is a phenols (CHEBI:33853) |
| (+)-(7S,8R,8'R)-5,5'-dimethoxylariciresinol (CHEBI:67650) is a primary alcohol (CHEBI:15734) |
| IUPAC Name |
|---|
| 4-[(2S,3R,4R)-4-(4-hydroxy-3,5-dimethoxybenzyl)-3-(hydroxymethyl)tetrahydrofuran-2-yl]-2,6-dimethoxyphenol |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4827002 | Reaxys |
| Citations |
|---|