EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H6O5 |
| Net Charge | 0 |
| Average Mass | 134.087 |
| Monoisotopic Mass | 134.02152 |
| SMILES | O=C(O)CC(O)C(=O)O |
| InChI | InChI=1S/C4H6O5/c5-2(4(8)9)1-3(6)7/h2,5H,1H2,(H,6,7)(H,8,9) |
| InChIKey | BJEPYKJPYRNKOW-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Daphnia magna (ncbitaxon:35525) | - | Article (Mixtures of similarly acting compounds in Daphnia magna: From gene to metabolite and beyond) |
| Roles Classification |
|---|
| Chemical Roles: | food acidity regulator A food additive that is used to change or otherwise control the acidity or alkalinity of foods. They may be acids, bases, neutralising agents or buffering agents. Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | fundamental metabolite Any metabolite produced by all living cells. food acidity regulator A food additive that is used to change or otherwise control the acidity or alkalinity of foods. They may be acids, bases, neutralising agents or buffering agents. |
| Application: | food acidity regulator A food additive that is used to change or otherwise control the acidity or alkalinity of foods. They may be acids, bases, neutralising agents or buffering agents. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| malic acid (CHEBI:6650) has functional parent succinic acid (CHEBI:15741) |
| malic acid (CHEBI:6650) has role food acidity regulator (CHEBI:64049) |
| malic acid (CHEBI:6650) has role fundamental metabolite (CHEBI:78675) |
| malic acid (CHEBI:6650) is a 2-hydroxydicarboxylic acid (CHEBI:50263) |
| malic acid (CHEBI:6650) is a C4-dicarboxylic acid (CHEBI:66873) |
| malic acid (CHEBI:6650) is conjugate acid of malate (CHEBI:25115) |
| malic acid (CHEBI:6650) is conjugate acid of malate(2−) (CHEBI:15595) |
| Incoming Relation(s) |
| 2-(p-coumaroyl)malic acid (CHEBI:134253) has functional parent malic acid (CHEBI:6650) |
| 2-(ω-methylthio)alkylmalic acid (CHEBI:134530) has functional parent malic acid (CHEBI:6650) |
| 2-hydroxy-3-(2-methylidenecyclopropyl)butanedioic acid (CHEBI:133310) has functional parent malic acid (CHEBI:6650) |
| 2-phosphinomethylmalic acid (CHEBI:81403) has functional parent malic acid (CHEBI:6650) |
| 2,3-dimethylmalic acid (CHEBI:15590) has functional parent malic acid (CHEBI:6650) |
| 3-(ω-methylthio)alkylmalic acid (CHEBI:134532) has functional parent malic acid (CHEBI:6650) |
| 3-carboxy-3-hydroxypropanoyl-CoA (CHEBI:137700) has functional parent malic acid (CHEBI:6650) |
| malate ester (CHEBI:36188) has functional parent malic acid (CHEBI:6650) |
| (R)-malic acid (CHEBI:30796) is a malic acid (CHEBI:6650) |
| (S)-malic acid (CHEBI:30797) is a malic acid (CHEBI:6650) |
| malate (CHEBI:25115) is conjugate base of malic acid (CHEBI:6650) |
| malate(2−) (CHEBI:15595) is conjugate base of malic acid (CHEBI:6650) |
| IUPAC Name |
|---|
| 2-hydroxybutanedioic acid |
| Synonyms | Source |
|---|---|
| 2-Hydroxybutanedioic acid | KEGG COMPOUND |
| 2-Hydroxyethane-1,2-dicarboxylic acid | HMDB |
| 2-Hydroxysuccinic acid | HMDB |
| Äpfelsäure | ChEBI |
| apple acid | NIST Chemistry WebBook |
| DL-Malic acid | HMDB |
| Manual Xrefs | Databases |
|---|---|
| 1352 | PPDB |
| C00711 | KEGG COMPOUND |
| D04843 | KEGG DRUG |
| HMDB0000744 | HMDB |
| Malic_acid | Wikipedia |
| RS-Malate | MetaCyc |
| Citations |
|---|