EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:6650 - malic acid
| Formula | C4H6O5 |
| Net Charge | 0 |
| Average Mass | 134.087 |
| Monoisotopic Mass | 134.02152 |
| SMILES | O=C(O)CC(O)C(=O)O |
| InChI | InChI=1S/C4H6O5/c5-2(4(8)9)1-3(6)7/h2,5H,1H2,(H,6,7)(H,8,9) |
| InChIKey | BJEPYKJPYRNKOW-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Daphnia magna (ncbitaxon:35525) | - | Article (Mixtures of similarly acting compounds in Daphnia magna: From gene to metabolite and beyond) |
| Roles Classification |
|---|
| Chemical Roles: | food acidity regulator A food additive that is used to change or otherwise control the acidity or alkalinity of foods. They may be acids, bases, neutralising agents or buffering agents. Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | food acidity regulator A food additive that is used to change or otherwise control the acidity or alkalinity of foods. They may be acids, bases, neutralising agents or buffering agents. fundamental metabolite Any metabolite produced by all living cells. |
| Application: | food acidity regulator A food additive that is used to change or otherwise control the acidity or alkalinity of foods. They may be acids, bases, neutralising agents or buffering agents. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| malic acid (CHEBI:6650) has functional parent succinic acid (CHEBI:15741) |
| malic acid (CHEBI:6650) has role food acidity regulator (CHEBI:64049) |
| malic acid (CHEBI:6650) has role fundamental metabolite (CHEBI:78675) |
| malic acid (CHEBI:6650) is a 2-hydroxydicarboxylic acid (CHEBI:50263) |
| malic acid (CHEBI:6650) is a C4-dicarboxylic acid (CHEBI:66873) |
| malic acid (CHEBI:6650) is conjugate acid of malate (CHEBI:25115) |
| malic acid (CHEBI:6650) is conjugate acid of malate(2−) (CHEBI:15595) |
| Incoming Relation(s) |
| 2-(p-coumaroyl)malic acid (CHEBI:134253) has functional parent malic acid (CHEBI:6650) |
| 2-(ω-methylthio)alkylmalic acid (CHEBI:134530) has functional parent malic acid (CHEBI:6650) |
| 2-hydroxy-3-(2-methylidenecyclopropyl)butanedioic acid (CHEBI:133310) has functional parent malic acid (CHEBI:6650) |
| 2-phosphinomethylmalic acid (CHEBI:81403) has functional parent malic acid (CHEBI:6650) |
| 2,3-dimethylmalic acid (CHEBI:15590) has functional parent malic acid (CHEBI:6650) |
| 3-(ω-methylthio)alkylmalic acid (CHEBI:134532) has functional parent malic acid (CHEBI:6650) |
| 3-carboxy-3-hydroxypropanoyl-CoA (CHEBI:137700) has functional parent malic acid (CHEBI:6650) |
| malate ester (CHEBI:36188) has functional parent malic acid (CHEBI:6650) |
| (R)-malic acid (CHEBI:30796) is a malic acid (CHEBI:6650) |
| (S)-malic acid (CHEBI:30797) is a malic acid (CHEBI:6650) |
| malate (CHEBI:25115) is conjugate base of malic acid (CHEBI:6650) |
| malate(2−) (CHEBI:15595) is conjugate base of malic acid (CHEBI:6650) |
| IUPAC Name |
|---|
| 2-hydroxybutanedioic acid |
| Synonyms | Source |
|---|---|
| 2-Hydroxybutanedioic acid | KEGG COMPOUND |
| 2-Hydroxyethane-1,2-dicarboxylic acid | HMDB |
| 2-Hydroxysuccinic acid | HMDB |
| Äpfelsäure | ChEBI |
| apple acid | NIST Chemistry WebBook |
| DL-Malic acid | HMDB |
| Manual Xrefs | Databases |
|---|---|
| 1352 | PPDB |
| C00711 | KEGG COMPOUND |
| D04843 | KEGG DRUG |
| HMDB0000744 | HMDB |
| Malic_acid | Wikipedia |
| RS-Malate | MetaCyc |
| Citations |
|---|