EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H10O5 |
| Net Charge | 0 |
| Average Mass | 186.163 |
| Monoisotopic Mass | 186.05282 |
| SMILES | C=C1CC1C(C(=O)O)C(O)C(=O)O |
| InChI | InChI=1S/C8H10O5/c1-3-2-4(3)5(7(10)11)6(9)8(12)13/h4-6,9H,1-2H2,(H,10,11)(H,12,13) |
| InChIKey | HEWAJTLQEJUAGF-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Glycine max (ncbitaxon:3847) | |||
| - | MetaboLights (MTBLS118) | ||
| - | MetaboLights (MTBLS117) | ||
| - | PubMed (25369450) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-hydroxy-3-(2-methylidenecyclopropyl)butanedioic acid (CHEBI:133310) has functional parent malic acid (CHEBI:6650) |
| 2-hydroxy-3-(2-methylidenecyclopropyl)butanedioic acid (CHEBI:133310) has role plant metabolite (CHEBI:76924) |
| 2-hydroxy-3-(2-methylidenecyclopropyl)butanedioic acid (CHEBI:133310) is a 2-hydroxydicarboxylic acid (CHEBI:50263) |
| 2-hydroxy-3-(2-methylidenecyclopropyl)butanedioic acid (CHEBI:133310) is a cyclopropanes (CHEBI:51454) |
| 2-hydroxy-3-(2-methylidenecyclopropyl)butanedioic acid (CHEBI:133310) is a olefinic compound (CHEBI:78840) |
| IUPAC Name |
|---|
| 2-hydroxy-3-(2-methylidenecyclopropyl)butanedioic acid |