EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H6O5 |
| Net Charge | 0 |
| Average Mass | 134.087 |
| Monoisotopic Mass | 134.02152 |
| SMILES | O=C(O)C[C@H](O)C(=O)O |
| InChI | InChI=1S/C4H6O5/c5-2(4(8)9)1-3(6)7/h2,5H,1H2,(H,6,7)(H,8,9)/t2-/m0/s1 |
| InChIKey | BJEPYKJPYRNKOW-REOHCLBHSA-N |
| Roles Classification |
|---|
| Chemical Roles: | food acidity regulator A food additive that is used to change or otherwise control the acidity or alkalinity of foods. They may be acids, bases, neutralising agents or buffering agents. Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | food acidity regulator A food additive that is used to change or otherwise control the acidity or alkalinity of foods. They may be acids, bases, neutralising agents or buffering agents. fundamental metabolite Any metabolite produced by all living cells. |
| Applications: | geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. food acidity regulator A food additive that is used to change or otherwise control the acidity or alkalinity of foods. They may be acids, bases, neutralising agents or buffering agents. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-malic acid (CHEBI:30797) has role geroprotector (CHEBI:176497) |
| (S)-malic acid (CHEBI:30797) is a malic acid (CHEBI:6650) |
| (S)-malic acid (CHEBI:30797) is conjugate acid of (S)-malate(2−) (CHEBI:15589) |
| (S)-malic acid (CHEBI:30797) is enantiomer of (R)-malic acid (CHEBI:30796) |
| Incoming Relation(s) |
| (S)-malyl N-acetyl-α-D-glucosaminide (CHEBI:64882) has functional parent (S)-malic acid (CHEBI:30797) |
| (S)-malyl α-D-glucosaminide (CHEBI:64888) has functional parent (S)-malic acid (CHEBI:30797) |
| (3S)-3-carboxy-3-hydroxypropanoyl-CoA (CHEBI:15454) has functional parent (S)-malic acid (CHEBI:30797) |
| (S)-malate(2−) (CHEBI:15589) is conjugate base of (S)-malic acid (CHEBI:30797) |
| (R)-malic acid (CHEBI:30796) is enantiomer of (S)-malic acid (CHEBI:30797) |
| IUPAC Name |
|---|
| (2S)-2-hydroxybutanedioic acid |
| Synonyms | Source |
|---|---|
| L-2-Hydroxybutanedioic acid | KEGG COMPOUND |
| L-Apple acid | KEGG COMPOUND |
| L-Malic acid | KEGG COMPOUND |
| Malate | KEGG COMPOUND |
| Malic acid | KEGG COMPOUND |
| S-2-Hydroxybutanedioic acid | HMDB |
| Citations |
|---|