EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H6O5 |
| Net Charge | 0 |
| Average Mass | 134.087 |
| Monoisotopic Mass | 134.02152 |
| SMILES | O=C(O)C[C@H](O)C(=O)O |
| InChI | InChI=1S/C4H6O5/c5-2(4(8)9)1-3(6)7/h2,5H,1H2,(H,6,7)(H,8,9)/t2-/m0/s1 |
| InChIKey | BJEPYKJPYRNKOW-REOHCLBHSA-N |
| Roles Classification |
|---|
| Chemical Roles: | food acidity regulator A food additive that is used to change or otherwise control the acidity or alkalinity of foods. They may be acids, bases, neutralising agents or buffering agents. Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | fundamental metabolite Any metabolite produced by all living cells. food acidity regulator A food additive that is used to change or otherwise control the acidity or alkalinity of foods. They may be acids, bases, neutralising agents or buffering agents. |
| Applications: | geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. food acidity regulator A food additive that is used to change or otherwise control the acidity or alkalinity of foods. They may be acids, bases, neutralising agents or buffering agents. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-malic acid (CHEBI:30797) has role geroprotector (CHEBI:176497) |
| (S)-malic acid (CHEBI:30797) is a malic acid (CHEBI:6650) |
| (S)-malic acid (CHEBI:30797) is conjugate acid of (S)-malate(2−) (CHEBI:15589) |
| (S)-malic acid (CHEBI:30797) is enantiomer of (R)-malic acid (CHEBI:30796) |
| Incoming Relation(s) |
| (S)-malyl N-acetyl-α-D-glucosaminide (CHEBI:64882) has functional parent (S)-malic acid (CHEBI:30797) |
| (S)-malyl α-D-glucosaminide (CHEBI:64888) has functional parent (S)-malic acid (CHEBI:30797) |
| (3S)-3-carboxy-3-hydroxypropanoyl-CoA (CHEBI:15454) has functional parent (S)-malic acid (CHEBI:30797) |
| (S)-malate(2−) (CHEBI:15589) is conjugate base of (S)-malic acid (CHEBI:30797) |
| (R)-malic acid (CHEBI:30796) is enantiomer of (S)-malic acid (CHEBI:30797) |
| IUPAC Name |
|---|
| (2S)-2-hydroxybutanedioic acid |
| Synonyms | Source |
|---|---|
| L-2-Hydroxybutanedioic acid | KEGG COMPOUND |
| L-Apple acid | KEGG COMPOUND |
| L-Malic acid | KEGG COMPOUND |
| Malate | KEGG COMPOUND |
| Malic acid | KEGG COMPOUND |
| S-2-Hydroxybutanedioic acid | HMDB |
| Citations |
|---|