EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:65480 - bellidin
| Formula | C13H8O6 |
| Net Charge | 0 |
| Average Mass | 260.201 |
| Monoisotopic Mass | 260.03209 |
| SMILES | O=c1c2c(O)cc(O)cc2oc2c(O)ccc(O)c12 |
| InChI | InChI=1S/C13H8O6/c14-5-3-8(17)10-9(4-5)19-13-7(16)2-1-6(15)11(13)12(10)18/h1-4,14-17H |
| InChIKey | MPXAWSABMVLIBU-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Gentiana bellidifolia (IPNI:367849-1) | - | DOI (10.1016/S0040-4020(01)98434-0) | |
| Gentiana lacteal (ncbitaxon:21496) | - | PubMed (3174858) | |
| Gentiana ramosa (IPNI:368797-1) | - | DOI (10.1016/S0031-9422(00)89285-7) | |
| Gentiana strictiflora (IPNI:368974-1) | - | DOI (10.1016/S0031-9422(00)84162-X) | |
| Gentianella campestris (ncbitaxon:49940) | - | PubMed (15490334) | |
| Iris nigricans (ncbitaxon:995810) | - | DOI (10.1016/0031-9422(94)00641-6) | |
| Swertia chirata (IPNI:60447539-2) | - | PubMed (4712626) | |
| Swertia davidi (IPNI:370864-1) | - | PubMed (15234768) | |
| Swertia dilatata (ncbitaxon:559635) | - | Article (YAKUGAKU ZASSHI,1974,94,647) | |
| Swertia erythrosticum (ncbitaxon:39241) | - | Article (ZHIWU XUEBAO,1992,34,886) | |
| Swertia gracilescens (IPNI:370915-1) | - | Article (YAKUGAKU ZASSHI,1974,94,647) | |
| Swertia hookeri (IPNI:370932-1) | - | DOI (10.1016/0031-9422(80)85027-8) | |
| Swertia japonica (ncbitaxon:137129) | - | DOI (10.1007/BF02675902) | |
| Swertia lawii (IPNI:370960-1) | - | DOI (10.1016/S0031-9422(00)98635-7) | |
| Swertia macrosperma (ncbitaxon:137130) | - | DOI (10.1016/0031-9422(89)80400-5) | |
| Swertia nervosa (ncbitaxon:363513) | - | Article (YAKUGAKU ZASSHI,1974,94,647) | |
| Swertia purpurascens (IPNI:371054-1) | - | PubMed (1133711) | |
| Swertia racemosa (ncbitaxon:137132) | - | Article (YAKUGAKU ZASSHI,1974,94,647) |
| Roles Classification |
|---|
| Chemical Roles: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. radical scavenger A role played by a substance that can react readily with, and thereby eliminate, radicals. |
| Biological Roles: | mutagen An agent that increases the frequency of mutations above the normal background level, usually by interacting directly with DNA and causing it damage, including base substitution. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. EC 3.1.1.7 (acetylcholinesterase) inhibitor An EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that interferes with the action of enzyme acetylcholinesterase (EC 3.1.1.7), which helps breaking down of acetylcholine into choline and acetic acid. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bellidin (CHEBI:65480) has functional parent xanthone (CHEBI:37647) |
| bellidin (CHEBI:65480) has role antioxidant (CHEBI:22586) |
| bellidin (CHEBI:65480) has role EC 3.1.1.7 (acetylcholinesterase) inhibitor (CHEBI:38462) |
| bellidin (CHEBI:65480) has role metabolite (CHEBI:25212) |
| bellidin (CHEBI:65480) has role mutagen (CHEBI:25435) |
| bellidin (CHEBI:65480) has role radical scavenger (CHEBI:48578) |
| bellidin (CHEBI:65480) is a tetrol (CHEBI:33573) |
| bellidin (CHEBI:65480) is a xanthones (CHEBI:51149) |
| Incoming Relation(s) |
| bellidifolin (CHEBI:3008) has functional parent bellidin (CHEBI:65480) |
| norswertianolin (CHEBI:7638) has functional parent bellidin (CHEBI:65480) |
| IUPAC Name |
|---|
| 1,3,5,8-tetrahydroxy-9H-xanthen-9-one |
| Synonyms | Source |
|---|---|
| 1,3,5,8-tetrahydroxyxanthen-9-one | ChEBI |
| 1,3,5,8-Tetrahydroxyxanthone | KEGG COMPOUND |
| Demethylbellidifolin | ChemIDplus |
| Desmethylbellidifolin | ChemIDplus |
| DMB | ChEBI |
| Citations |
|---|