EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:65480 - bellidin
| Formula | C13H8O6 |
| Net Charge | 0 |
| Average Mass | 260.201 |
| Monoisotopic Mass | 260.03209 |
| SMILES | O=c1c2c(O)cc(O)cc2oc2c(O)ccc(O)c12 |
| InChI | InChI=1S/C13H8O6/c14-5-3-8(17)10-9(4-5)19-13-7(16)2-1-6(15)11(13)12(10)18/h1-4,14-17H |
| InChIKey | MPXAWSABMVLIBU-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Swertia japonica (ncbitaxon:137129) | - | DOI (10.1007/BF02675902) | |
| Gentianella campestris (ncbitaxon:49940) | - | PubMed (15490334) | |
| Gentiana bellidifolia (IPNI:367849-1) | - | DOI (10.1016/S0040-4020(01)98434-0) | |
| Swertia erythrosticum (ncbitaxon:39241) | - | Article (ZHIWU XUEBAO,1992,34,886) | |
| Iris nigricans (ncbitaxon:995810) | - | DOI (10.1016/0031-9422(94)00641-6) | |
| Swertia nervosa (ncbitaxon:363513) | - | Article (YAKUGAKU ZASSHI,1974,94,647) | |
| Swertia lawii (IPNI:370960-1) | - | DOI (10.1016/S0031-9422(00)98635-7) | |
| Swertia purpurascens (IPNI:371054-1) | - | PubMed (1133711) | |
| Swertia hookeri (IPNI:370932-1) | - | DOI (10.1016/0031-9422(80)85027-8) | |
| Swertia gracilescens (IPNI:370915-1) | - | Article (YAKUGAKU ZASSHI,1974,94,647) | |
| Gentiana lacteal (ncbitaxon:21496) | - | PubMed (3174858) | |
| Gentiana ramosa (IPNI:368797-1) | - | DOI (10.1016/S0031-9422(00)89285-7) | |
| Swertia racemosa (ncbitaxon:137132) | - | Article (YAKUGAKU ZASSHI,1974,94,647) | |
| Swertia dilatata (ncbitaxon:559635) | - | Article (YAKUGAKU ZASSHI,1974,94,647) | |
| Gentiana strictiflora (IPNI:368974-1) | - | DOI (10.1016/S0031-9422(00)84162-X) | |
| Swertia davidi (IPNI:370864-1) | - | PubMed (15234768) | |
| Swertia macrosperma (ncbitaxon:137130) | - | DOI (10.1016/0031-9422(89)80400-5) | |
| Swertia chirata (IPNI:60447539-2) | - | PubMed (4712626) |
| Roles Classification |
|---|
| Chemical Roles: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. radical scavenger A role played by a substance that can react readily with, and thereby eliminate, radicals. |
| Biological Roles: | EC 3.1.1.7 (acetylcholinesterase) inhibitor An EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that interferes with the action of enzyme acetylcholinesterase (EC 3.1.1.7), which helps breaking down of acetylcholine into choline and acetic acid. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. mutagen An agent that increases the frequency of mutations above the normal background level, usually by interacting directly with DNA and causing it damage, including base substitution. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bellidin (CHEBI:65480) has functional parent xanthone (CHEBI:37647) |
| bellidin (CHEBI:65480) has role antioxidant (CHEBI:22586) |
| bellidin (CHEBI:65480) has role EC 3.1.1.7 (acetylcholinesterase) inhibitor (CHEBI:38462) |
| bellidin (CHEBI:65480) has role metabolite (CHEBI:25212) |
| bellidin (CHEBI:65480) has role mutagen (CHEBI:25435) |
| bellidin (CHEBI:65480) has role radical scavenger (CHEBI:48578) |
| bellidin (CHEBI:65480) is a tetrol (CHEBI:33573) |
| bellidin (CHEBI:65480) is a xanthones (CHEBI:51149) |
| Incoming Relation(s) |
| bellidifolin (CHEBI:3008) has functional parent bellidin (CHEBI:65480) |
| norswertianolin (CHEBI:7638) has functional parent bellidin (CHEBI:65480) |
| IUPAC Name |
|---|
| 1,3,5,8-tetrahydroxy-9H-xanthen-9-one |
| Synonyms | Source |
|---|---|
| Desmethylbellidifolin | ChemIDplus |
| Demethylbellidifolin | ChemIDplus |
| 1,3,5,8-tetrahydroxyxanthen-9-one | ChEBI |
| DMB | ChEBI |
| 1,3,5,8-Tetrahydroxyxanthone | KEGG COMPOUND |
| Citations |
|---|