EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:3008 - bellidifolin
| Formula | C14H10O6 |
| Net Charge | 0 |
| Average Mass | 274.228 |
| Monoisotopic Mass | 274.04774 |
| SMILES | COc1cc(O)c2c(=O)c3c(O)ccc(O)c3oc2c1 |
| InChI | InChI=1S/C14H10O6/c1-19-6-4-9(17)11-10(5-6)20-14-8(16)3-2-7(15)12(14)13(11)18/h2-5,15-17H,1H3 |
| InChIKey | JDIORNFCMMYMLF-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Gentiana algida (ncbitaxon:50748) | - | DOI (10.1007/BF00630190) | |
| Gentiana bellidifolia (IPNI:367849-1) | - | DOI (10.1016/S0040-4020(01)98434-0) | |
| Gentianella campestris (ncbitaxon:49940) | - | DOI (10.1002/hlca.19740570831) | |
| Swertia chirata (IPNI:60447539-2) | - | DOI (10.1107/S1600536804009171) | |
| Swertia ciliata (ncbitaxon:166614) | - | Article (J CHEM SOC PAK,2000,22,122) | |
| Swertia franchetiana (ncbitaxon:50785) | - | DOI (10.1016/j.bse.2004.02.008) | |
| Swertia japonica (ncbitaxon:137129) | - | DOI (10.1016/0031-9422(90)80122-W) | |
| Swertia paniculata (ncbitaxon:559637) | - | PubMed (20614821) | |
| Swertia petiolata (ncbitaxon:39380) | - | Article (ACTA CIENC INDICA SER GEM,1981,7,31) | |
| Swertia punctata (IPNI:371052-1) | - | DOI (10.1016/S0031-9422(02)00231-5) | |
| Swertia speciosa (IPNI:371090-1) | - | DOI (10.1016/0031-9422(88)80481-3) |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. EC 3.1.1.7 (acetylcholinesterase) inhibitor An EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that interferes with the action of enzyme acetylcholinesterase (EC 3.1.1.7), which helps breaking down of acetylcholine into choline and acetic acid. |
| Application: | hypoglycemic agent A drug which lowers the blood glucose level. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bellidifolin (CHEBI:3008) has functional parent bellidin (CHEBI:65480) |
| bellidifolin (CHEBI:3008) has role EC 3.1.1.7 (acetylcholinesterase) inhibitor (CHEBI:38462) |
| bellidifolin (CHEBI:3008) has role hypoglycemic agent (CHEBI:35526) |
| bellidifolin (CHEBI:3008) has role metabolite (CHEBI:25212) |
| bellidifolin (CHEBI:3008) is a polyphenol (CHEBI:26195) |
| bellidifolin (CHEBI:3008) is a xanthones (CHEBI:51149) |
| Incoming Relation(s) |
| swerchirin (CHEBI:9368) has functional parent bellidifolin (CHEBI:3008) |
| swertianolin (CHEBI:65478) has functional parent bellidifolin (CHEBI:3008) |
| IUPAC Name |
|---|
| 1,5,8-trihydroxy-3-methoxy-9H-xanthen-9-one |
| Synonyms | Source |
|---|---|
| 3-Methoxy-1,5,8-trihydroxyxanthone | KEGG COMPOUND |
| Bellidifoline | ChemIDplus |
| Bellidifolium | ChemIDplus |
| Citations |
|---|