EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:3008 - bellidifolin
| Formula | C14H10O6 |
| Net Charge | 0 |
| Average Mass | 274.228 |
| Monoisotopic Mass | 274.04774 |
| SMILES | COc1cc(O)c2c(=O)c3c(O)ccc(O)c3oc2c1 |
| InChI | InChI=1S/C14H10O6/c1-19-6-4-9(17)11-10(5-6)20-14-8(16)3-2-7(15)12(14)13(11)18/h2-5,15-17H,1H3 |
| InChIKey | JDIORNFCMMYMLF-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Gentiana algida (ncbitaxon:50748) | - | DOI (10.1007/BF00630190) | |
| Gentiana bellidifolia (IPNI:367849-1) | - | DOI (10.1016/S0040-4020(01)98434-0) | |
| Gentianella campestris (ncbitaxon:49940) | - | DOI (10.1002/hlca.19740570831) | |
| Swertia chirata (IPNI:60447539-2) | - | DOI (10.1107/S1600536804009171) | |
| Swertia ciliata (ncbitaxon:166614) | - | Article (J CHEM SOC PAK,2000,22,122) | |
| Swertia franchetiana (ncbitaxon:50785) | - | DOI (10.1016/j.bse.2004.02.008) | |
| Swertia japonica (ncbitaxon:137129) | - | DOI (10.1016/0031-9422(90)80122-W) | |
| Swertia paniculata (ncbitaxon:559637) | - | PubMed (20614821) | |
| Swertia petiolata (ncbitaxon:39380) | - | Article (ACTA CIENC INDICA SER GEM,1981,7,31) | |
| Swertia punctata (IPNI:371052-1) | - | DOI (10.1016/S0031-9422(02)00231-5) | |
| Swertia speciosa (IPNI:371090-1) | - | DOI (10.1016/0031-9422(88)80481-3) |
| Roles Classification |
|---|
| Biological Roles: | EC 3.1.1.7 (acetylcholinesterase) inhibitor An EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that interferes with the action of enzyme acetylcholinesterase (EC 3.1.1.7), which helps breaking down of acetylcholine into choline and acetic acid. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | hypoglycemic agent A drug which lowers the blood glucose level. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bellidifolin (CHEBI:3008) has functional parent bellidin (CHEBI:65480) |
| bellidifolin (CHEBI:3008) has role EC 3.1.1.7 (acetylcholinesterase) inhibitor (CHEBI:38462) |
| bellidifolin (CHEBI:3008) has role hypoglycemic agent (CHEBI:35526) |
| bellidifolin (CHEBI:3008) has role metabolite (CHEBI:25212) |
| bellidifolin (CHEBI:3008) is a polyphenol (CHEBI:26195) |
| bellidifolin (CHEBI:3008) is a xanthones (CHEBI:51149) |
| Incoming Relation(s) |
| swerchirin (CHEBI:9368) has functional parent bellidifolin (CHEBI:3008) |
| swertianolin (CHEBI:65478) has functional parent bellidifolin (CHEBI:3008) |
| IUPAC Name |
|---|
| 1,5,8-trihydroxy-3-methoxy-9H-xanthen-9-one |
| Synonyms | Source |
|---|---|
| 3-Methoxy-1,5,8-trihydroxyxanthone | KEGG COMPOUND |
| Bellidifoline | ChemIDplus |
| Bellidifolium | ChemIDplus |
| Citations |
|---|