EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H8O2 |
| Net Charge | 0 |
| Average Mass | 196.205 |
| Monoisotopic Mass | 196.05243 |
| SMILES | O=c1c2ccccc2oc2ccccc12 |
| InChI | InChI=1S/C13H8O2/c14-13-9-5-1-3-7-11(9)15-12-8-4-2-6-10(12)13/h1-8H |
| InChIKey | JNELGWHKGNBSMD-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Application: | insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| xanthone (CHEBI:37647) has role insecticide (CHEBI:24852) |
| xanthone (CHEBI:37647) is a xanthones (CHEBI:51149) |
| Incoming Relation(s) |
| bellidin (CHEBI:65480) has functional parent xanthone (CHEBI:37647) |
| mangiferin (CHEBI:6682) has functional parent xanthone (CHEBI:37647) |
| vieillardixanthone (CHEBI:66367) has functional parent xanthone (CHEBI:37647) |
| IUPAC Name |
|---|
| 9H-xanthen-9-one |
| Synonyms | Source |
|---|---|
| 9-oxoxanthene | ChemIDplus |
| 9-xanthenone | ChemIDplus |
| 9-xanthone | NIST Chemistry WebBook |
| benzophenone oxide | ChemIDplus |
| diphenylene ketone oxide | ChemIDplus |
| xanthenone | ChemIDplus |
| Brand Name | Source |
|---|---|
| Genicide | NIST Chemistry WebBook |