EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H18O11 |
| Net Charge | 0 |
| Average Mass | 422.342 |
| Monoisotopic Mass | 422.08491 |
| SMILES | O=c1c2c(O)cc(O)cc2oc2c(O)ccc(O[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)c12 |
| InChI | InChI=1S/C19H18O11/c20-5-11-14(24)16(26)17(27)19(30-11)29-9-2-1-7(22)18-13(9)15(25)12-8(23)3-6(21)4-10(12)28-18/h1-4,11,14,16-17,19-24,26-27H,5H2/t11-,14-,16+,17-,19-/m1/s1 |
| InChIKey | MYWLBRTZOYHDOU-FJMCMGCSSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Gentiana ramosa (IPNI:368797-1) | - | DOI (10.1016/S0031-9422(00)89285-7) | |
| Gentiana germanica (IPNI:368223-1) | - | DOI (10.1016/S0031-9422(00)89285-7) | |
| Gentianella campestris (ncbitaxon:49940) | - | PubMed (15490334) | |
| Swertia randaiensis (IPNI:371063-1) | - | Article (INDIAN J CHEM,1980,19B,10,929) | |
| Swertia japonica (ncbitaxon:137129) | - | DOI (10.1248/cpb.30.4088) |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. EC 3.1.1.7 (acetylcholinesterase) inhibitor An EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that interferes with the action of enzyme acetylcholinesterase (EC 3.1.1.7), which helps breaking down of acetylcholine into choline and acetic acid. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| norswertianolin (CHEBI:7638) has functional parent bellidin (CHEBI:65480) |
| norswertianolin (CHEBI:7638) has role EC 3.1.1.7 (acetylcholinesterase) inhibitor (CHEBI:38462) |
| norswertianolin (CHEBI:7638) has role metabolite (CHEBI:25212) |
| norswertianolin (CHEBI:7638) is a xanthones (CHEBI:51149) |
| norswertianolin (CHEBI:7638) is a β-D-glucoside (CHEBI:22798) |
| IUPAC Name |
|---|
| 4,6,8-trihydroxy-9-oxo-9H-xanthen-1-yl β-D-glucopyranoside |
| Synonyms | Source |
|---|---|
| 8-(β-D-glucopyranosyloxy)-1,3,5-trihydroxy-9H-xanthen-9-one | ChemIDplus |
| bellidin-8-O-β-D-glucopyranoside | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1694897 | Reaxys |
| CAS:54954-12-0 | KEGG COMPOUND |
| CAS:54954-12-0 | ChemIDplus |
| Citations |
|---|