EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H43NO2 |
| Net Charge | 0 |
| Average Mass | 329.569 |
| Monoisotopic Mass | 329.32938 |
| SMILES | CCCCCCCCCCCCCCCCC[C@@H](O)[C@@H](N)CO |
| InChI | InChI=1S/C20H43NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20(23)19(21)18-22/h19-20,22-23H,2-18,21H2,1H3/t19-,20+/m0/s1 |
| InChIKey | UFMHYBVQZSPWSS-VQTJNVASSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | - | MetaboLights (MTBLS143) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| C20 sphinganine (CHEBI:64905) has role mouse metabolite (CHEBI:75771) |
| C20 sphinganine (CHEBI:64905) is a 2-aminoicosane-1,3-diol (CHEBI:64907) |
| C20 sphinganine (CHEBI:64905) is conjugate base of C20 sphinganine(1+) (CHEBI:64887) |
| Incoming Relation(s) |
| N-acylicosasphinganine-1-phosphocholine (CHEBI:82900) has functional parent C20 sphinganine (CHEBI:64905) |
| N-acylicosasphinganine-1-phosphoethanolamine (CHEBI:83755) has functional parent C20 sphinganine (CHEBI:64905) |
| N-acylicosasphinganine-1-phosphoethanolamine zwitterion (CHEBI:82908) has functional parent C20 sphinganine (CHEBI:64905) |
| C20 3-dehydrosphinganine (CHEBI:65118) has functional parent C20 sphinganine (CHEBI:64905) |
| C20 dihydroceramide (CHEBI:71984) has functional parent C20 sphinganine (CHEBI:64905) |
| C20 phytosphingosine (CHEBI:64910) has functional parent C20 sphinganine (CHEBI:64905) |
| C20 sphinganine 1-phosphate (CHEBI:64917) has functional parent C20 sphinganine (CHEBI:64905) |
| inositol phosphomannosylinositol-1-phospho-C20-dihydroceramide (CHEBI:139532) has functional parent C20 sphinganine (CHEBI:64905) |
| β-D-galactosyl-(1→4)-β-D-glucosyl-(1↔1')-N-acylicosasphinganine (CHEBI:82990) has functional parent C20 sphinganine (CHEBI:64905) |
| C20 sphinganine(1+) (CHEBI:64887) is conjugate acid of C20 sphinganine (CHEBI:64905) |
| IUPAC Name |
|---|
| (2S,3R)-2-aminoicosane-1,3-diol |
| Synonyms | Source |
|---|---|
| d20:0 | ChEBI |
| DHS (C20) | MetaCyc |
| dihydrosphingosine (C20) | MetaCyc |
| eicosadihydrosphingosine | MetaCyc |
| eicosasphinganine | MetaCyc |
| erythro-D-sphinganine (C20) | MetaCyc |
| Manual Xrefs | Databases |
|---|---|
| CPD-13611 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6091539 | Reaxys |
| CAS:24006-62-0 | Reaxys |
| Citations |
|---|