EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H41NO2 |
| Net Charge | 0 |
| Average Mass | 327.553 |
| Monoisotopic Mass | 327.31373 |
| SMILES | CCCCCCCCCCCCCCCCCC(=O)[C@@H](N)CO |
| InChI | InChI=1S/C20H41NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20(23)19(21)18-22/h19,22H,2-18,21H2,1H3/t19-/m0/s1 |
| InChIKey | FVOLNXKBISLPQY-IBGZPJMESA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| C20 3-dehydrosphinganine (CHEBI:65118) has functional parent C20 sphinganine (CHEBI:64905) |
| C20 3-dehydrosphinganine (CHEBI:65118) is a sphingoid (CHEBI:35785) |
| C20 3-dehydrosphinganine (CHEBI:65118) is conjugate base of C20 3-dehydrosphinganine(1+) (CHEBI:65073) |
| Incoming Relation(s) |
| C20 3-dehydrosphinganine(1+) (CHEBI:65073) is conjugate acid of C20 3-dehydrosphinganine (CHEBI:65118) |
| IUPAC Name |
|---|
| (2S)-2-amino-1-hydroxyicosan-3-one |
| Synonyms | Source |
|---|---|
| 2-amino-1-hydroxyicosan-3-one | MetaCyc |
| (2S)-2-amino-1-hydroxyeicosan-3-one | ChEBI |
| 3-dehydro-D-sphinganine (C20) | MetaCyc |
| 3-dehydroeicosadihydrosphingosine | MetaCyc |
| 3-dehydroeicosasphinganine | MetaCyc |
| 3-ketodihydrosphinganine (C20) | MetaCyc |
| Manual Xrefs | Databases |
|---|---|
| CPD-13610 | MetaCyc |