EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H43NO3 |
| Net Charge | 0 |
| Average Mass | 345.568 |
| Monoisotopic Mass | 345.32429 |
| SMILES | CCCCCCCCCCCCCCCC[C@@H](O)[C@@H](O)[C@@H](N)CO |
| InChI | InChI=1S/C20H43NO3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-19(23)20(24)18(21)17-22/h18-20,22-24H,2-17,21H2,1H3/t18-,19+,20-/m0/s1 |
| InChIKey | UQAUXYMLKGFKBX-ZCNNSNEGSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| C20 phytosphingosine (CHEBI:64910) has functional parent C20 sphinganine (CHEBI:64905) |
| C20 phytosphingosine (CHEBI:64910) is a sphingoid (CHEBI:35785) |
| C20 phytosphingosine (CHEBI:64910) is conjugate base of C20 phytosphingosine(1+) (CHEBI:64885) |
| Incoming Relation(s) |
| N-acylicosaphytosphingosine-1-phosphocholine (CHEBI:82902) has functional parent C20 phytosphingosine (CHEBI:64910) |
| N-acylicosaphytosphingosine-1-phosphoethanolamine (CHEBI:83756) has functional parent C20 phytosphingosine (CHEBI:64910) |
| N-acylicosaphytosphingosine-1-phosphoethanolamine zwitterion (CHEBI:82909) has functional parent C20 phytosphingosine (CHEBI:64910) |
| C20 phytoceramide (CHEBI:71985) has functional parent C20 phytosphingosine (CHEBI:64910) |
| C20 phytosphingosine 1-phosphate (CHEBI:64918) has functional parent C20 phytosphingosine (CHEBI:64910) |
| inositol phosphomannosylinositol-1-phospho-C20-phytoceramide (CHEBI:139530) has functional parent C20 phytosphingosine (CHEBI:64910) |
| C20 phytosphingosine(1+) (CHEBI:64885) is conjugate acid of C20 phytosphingosine (CHEBI:64910) |
| IUPAC Name |
|---|
| (2S,3S,4R)-2-aminoicosane-1,3,4-triol |
| Synonym | Source |
|---|---|
| (2S,3S,4R)-2-aminoeicosane-1,3,4-triol | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7290433 | Reaxys |
| Citations |
|---|