EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H28N |
| Net Charge | +1 |
| Average Mass | 282.451 |
| Monoisotopic Mass | 282.22163 |
| SMILES | CC[NH+](CCCc1ccccc1)CCCc1ccccc1 |
| InChI | InChI=1S/C20H27N/c1-2-21(17-9-15-19-11-5-3-6-12-19)18-10-16-20-13-7-4-8-14-20/h3-8,11-14H,2,9-10,15-18H2,1H3/p+1 |
| InChIKey | ZPFXAOWNKLFJDN-UHFFFAOYSA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| alverine(1+) (CHEBI:64320) is a ammonium ion derivative (CHEBI:35274) |
| alverine(1+) (CHEBI:64320) is conjugate acid of alverine (CHEBI:518413) |
| Incoming Relation(s) |
| alverine citrate (CHEBI:53785) has part alverine(1+) (CHEBI:64320) |
| alverine hydrochloride (CHEBI:53786) has part alverine(1+) (CHEBI:64320) |
| alverine (CHEBI:518413) is conjugate base of alverine(1+) (CHEBI:64320) |
| IUPAC Name |
|---|
| N-ethyl-3-phenyl-N-(3-phenylpropyl)propan-1-aminium |