EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H27N |
| Net Charge | 0 |
| Average Mass | 281.443 |
| Monoisotopic Mass | 281.21435 |
| SMILES | CCN(CCCc1ccccc1)CCCc1ccccc1 |
| InChI | InChI=1S/C20H27N/c1-2-21(17-9-15-19-11-5-3-6-12-19)18-10-16-20-13-7-4-8-14-20/h3-8,11-14H,2,9-10,15-18H2,1H3 |
| InChIKey | ZPFXAOWNKLFJDN-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | antispasmodic drug A drug that suppresses spasms. These are usually caused by smooth muscle contraction, especially in tubular organs. The effect is to prevent spasms of the stomach, intestine or urinary bladder. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| alverine (CHEBI:518413) has role antispasmodic drug (CHEBI:53784) |
| alverine (CHEBI:518413) is a tertiary amine (CHEBI:32876) |
| alverine (CHEBI:518413) is conjugate base of alverine(1+) (CHEBI:64320) |
| Incoming Relation(s) |
| alverine(1+) (CHEBI:64320) is conjugate acid of alverine (CHEBI:518413) |
| IUPAC Name |
|---|
| N-ethyl-3-phenyl-N-(3-phenylpropyl)propan-1-amine |
| INNs | Source |
|---|---|
| alverina | DrugBank |
| alverine | KEGG DRUG |
| alverinum | DrugBank |
| Synonyms | Source |
|---|---|
| Bis(gamma-phenylpropyl)ethylamine | DrugBank |
| Di(phenylpropyl)ethylamine | DrugBank |
| N-Ethyl-3,3'-diphenyldipropylamine | DrugBank |
| N-Ethyl-3-phenyl-N-(3-phenylpropyl)-1-propanamine | NIST Chemistry WebBook |
| N-Ethyl-N-(3-phenylpropyl)benzenepropanamine | DrugBank |
| N,N-Bis(3-phenylpropyl)ethylamine | ChemIDplus |